From Surf Wiki (app.surf) — the open knowledge base
4C-T-2
Chemical compound
Chemical compound
| Field | Value | ||||
|---|---|---|---|---|---|
| verifiedrevid | 477223594 | ||||
| image | 4C-T-2 skeletal.svg | ||||
| image_class | skin-invert-image | ||||
| width | 250px | ||||
| legal_status | Uncontrolled | ||||
| ATC_prefix | None | ||||
| CAS_number_Ref | |||||
| CAS_number | 850007-13-5 | ||||
| UNII_Ref | |||||
| UNII | AY9HDQ4A2H | ||||
| CAS_supplemental | |||||
| 849919-79-5 (hydrochloride) | |||||
| PubChem | 11197523 | ||||
| ChemSpiderID_Ref | |||||
| ChemSpiderID | 9372592 | ||||
| ChEMBL_Ref | |||||
| ChEMBL | 372719 | ||||
| synonyms | 4-Ethylthio-2,5-dimethoxy-α-ethylphenethylamine | ||||
| IUPAC_name | 1-[(2,5-dimethoxy-4-ethylthio)phenyl]butan-2-amine | ||||
| C | 14 | H=23 | N=1 | O=2 | S=1 |
| SMILES | COC1=C(CC(CC)N)C=C(OC)C(SCC)=C1 | ||||
| StdInChI_Ref | |||||
| StdInChI | 1S/C14H23NO2S/c1-5-11(15)7-10-8-13(17-4)14(18-6-2)9-12(10)16-3/h8-9,11H,5-7,15H2,1-4H3 | ||||
| StdInChIKey_Ref | |||||
| StdInChIKey | KLAWPCIXPDTGCZ-UHFFFAOYSA-N |
| elimination_half-life =
849919-79-5 (hydrochloride)
4C-T-2, also known as 2,5-dimethoxy-4-ethylthio-α-ethylphenethylamine, is a synthetic drug of the phenethylamine, phenylisobutylamine, and 4C families. It is the α-ethylated analogue of 2C-T-2.
Pharmacology
Pharmacodynamics
| Target | Affinity (Ki, nM) |
|---|---|
| [5-HT1A](5-ht1a-receptor) | 5,339 |
| [5-HT1B](5-ht1b-receptor) | 10,000 |
| [5-HT1D](5-ht1d-receptor) | 10,000 |
| [5-HT1E](5-ht1e-receptor) | 9,879 |
| [5-HT1F](5-ht1f-receptor) | ND |
| [5-HT2A](5-ht2a-receptor) | 274 (Ki) |
| 13.1–53 () | |
| 78% () | |
| [5-HT2B](5-ht2b-receptor) | 58.1 (Ki) |
| 630 (EC50) | |
| ND (Emax) | |
| [5-HT2C](5-ht2c-receptor) | 469 (Ki) |
| 7.3–13.2 (EC50) | |
| 86–121% (Emax) | |
| [5-HT3](5-ht3-receptor) | 10,000 |
| [5-HT4](5-ht4-receptor) | ND |
| [5-HT5A](5-ht5a-receptor) | 1,587 |
| [5-HT6](5-ht6-receptor) | 10,000 |
| [5-HT7](5-ht7-receptor) | 3,829 |
| α1A, α1B | 10,000 |
| α1D | ND |
| α2A–α2C | 10,000 |
| β1 | 10,000 |
| β2 | 124.9 |
| β3 | ND |
| D1, D2 | 10,000 |
| D3 | 1,273 |
| D4, D5 | 10,000 |
| H1–H4 | 10,000 |
| M1–M5 | 10,000 |
| I1 | 946.5 |
| σ1 | 514.6 |
| σ2 | 10,000 |
| ND | |
| 10,000 (Ki) | |
| 10,000 (Ki) | |
| 10,000 (Ki) | |
| 11,800 () | |
| 100,000 (IC50) | |
| **Notes:** The smaller the value, the more avidly the drug binds to the site. All proteins are human unless otherwise specified. **Refs:** |
4C-T-2 acts as a serotonin 5-HT2 receptor agonist, including of the serotonin 5-HT2A, 5-HT2B, and 5-HT2C receptors.
History
4C-T-2 was first described in the scientific literature by at least 2005. It was more fully characterized in 2010 and then in 2023.
References
References
- (2011). "The Shulgin Index, Volume One: Psychedelic Phenethylamines and Related Compounds". [[Transform Press]].
- (1 April 2025). "Kᵢ Database".
- "BindingDB BDBM50164331 1-(4-Ethylsulfanyl-2,5-dimethoxy-benzyl)-propylamine::CHEMBL372719".
- (February 2010). "Psychedelics and the human receptorome". PLOS ONE.
- (January 2023). "Pharmacological Mechanism of the Non-hallucinogenic 5-HT2A Agonist Ariadne and Analogs". ACS Chemical Neuroscience.
- (April 2005). "Sulfur-substituted alpha-alkyl phenethylamines as selective and reversible MAO-A inhibitors: biological activities, CoMFA analysis, and active site modeling". Journal of Medicinal Chemistry.
This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page.
Ask Mako anything about 4C-T-2 — get instant answers, deeper analysis, and related topics.
Research with MakoFree with your Surf account
Create a free account to save articles, ask Mako questions, and organize your research.
Sign up freeThis content may have been generated or modified by AI. CloudSurf Software LLC is not responsible for the accuracy, completeness, or reliability of AI-generated content. Always verify important information from primary sources.
Report