Toltrazuril

Quality 0.50 · 2 views · Updated 2 months ago

Chemical compound

title: "Toltrazuril" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["antiparasitic-agents", "thioethers", "phenol-ethers", "isocyanuric-acids", "trifluoromethylthio-compounds"] description: "Chemical compound" topic_path: "general/antiparasitic-agents" source: "https://en.wikipedia.org/wiki/Toltrazuril" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | verifiedrevid = 448215930 | image = Toltrazuril.png | image_class = skin-invert-image | width = 240 | alt = | image2 = Toltrazuril molecule ball.png | image_class2 = bg-transparent | alt2 = Ball-and-stick model of the toltrazuril

| tradename = Baycox, Tolcox | Drugs.com = | pregnancy_AU = | pregnancy_category = | routes_of_administration = | ATCvet = yes | ATC_prefix = P51 | ATC_suffix = BC01 | ATC_supplemental =

| legal_AU = | legal_CA = Rx-only | legal_CA_comment = | legal_UK = | legal_US = | legal_status =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = 69004-03-1 | PubChem = 68591 | ChEMBL_Ref = | ChEMBL = 2104931 | ChemSpiderID_Ref = | ChemSpiderID = 61859 | DrugBank_Ref = | DrugBank = | UNII_Ref = | UNII = QVZ3IAR3JS | KEGG_Ref = | KEGG = D06187

| IUPAC_name = 1-methyl-3-[3-methyl-4-[4-(trifluoromethylthio)phenoxy]phenyl]-1,3,5-triazinane-2,4,6-trione | C=18 | H=14 | F=3 | N=3 | O=4 | S=1 | smiles = CC1=C(C=CC(=C1)N2C(=O)NC(=O)N(C2=O)C)OC3=CC=C(C=C3)SC(F)(F)F | StdInChI_Ref = | StdInChI=1S/C18H14F3N3O4S/c1-10-9-11(24-16(26)22-15(25)23(2)17(24)27)3-8-14(10)28-12-4-6-13(7-5-12)29-18(19,20)21/h3-9H,1-2H3,(H,22,25,26) | StdInChIKey_Ref = | StdInChIKey = OCINXEZVIIVXFU-UHFFFAOYSA-N

Toltrazuril is an antiparasitic medication used primarily to treat coccidiosis in animals. Coccidiosis is a parasitic disease caused by coccidia, which are microscopic, spore-forming, single-celled obligate intracellular parasites belonging to the apicomplexan class Conoidasida.

Mechanism of action

Toltrazuril works by interfering with the protozoa's ability to reproduce. It disrupts the division of the protozoal nucleus and damages the cell membrane of the parasites. This action results in the destruction of the coccidia at all stages of their life cycle.

Use in veterinary medicine

Toltrazuril is widely used in veterinary medicine to treat coccidiosis in various animals, including poultry, pigs, cattle, sheep, and companion animals like dogs and cats. It is often administered as a single dose or in a series of doses depending on the severity of the infection and the species being treated.

References

References

  1. (August 2013). "Efficacy of toltrazuril 5 % suspension (Baycox®, Bayer) and diclazuril (Vecoxan®, Janssen-Cilag) in the control of Eimeria spp. in lambs". Parasitology Research.
  2. "Toltrazuril - referral". European Medicines Agency.
  3. (January 2014). "Advances in exotic mammal clinical therapeutics.". Journal of Exotic Pet Medicine.
  4. (1986). "Efficacy of toltrazuril in the prevention of coccidiosis in naturally infected lambs on pasture". Acta Veterinaria Scandinavica.
  5. (January 2007). "Toltrazuril treatment for acute clinical coccidiosis in hair goat kids: clinical pathological, haematologic and biochemical findings". Medycyna Weterynaryjna.
  6. (2003). "Coccidiosis control with toltrazuril in conjunction with anticoccidial medicated or nonmedicated feed". Avian Diseases.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

antiparasitic-agentsthioethersphenol-ethersisocyanuric-acidstrifluoromethylthio-compounds