Halofuginone

Chemical compound


title: "Halofuginone" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["antiparasitic-agents", "bromoarenes", "chloroarenes", "piperidines", "secondary-alcohols", "quinazolinones", "lactams", "veterinary-drugs"] description: "Chemical compound" topic_path: "general/antiparasitic-agents" source: "https://en.wikipedia.org/wiki/Halofuginone" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 444144628 | image = Halofuginone.png | image_class = skin-invert-image | width = 180 | image2 = Halofuginone molecule ball.png | image_class2 = bg-transparent | width2 = 240 | alt2 = Ball-and-stick model of the halofuginone molecule

| tradename = Halocur | Drugs.com = | pregnancy_AU = | pregnancy_category = | routes_of_administration = | ATCvet = yes | ATC_prefix = P51 | ATC_suffix = BX01

| legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_EU = Rx-only | legal_EU_comment = | legal_status =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| index_label = | index2_label = | CAS_number_Ref = | CAS_number = 55837-20-2 | DrugBank_Ref = | DrugBank = | ChEMBL_Ref = | ChEMBL = 1199540 | UNII_Ref = | UNII = L31MM1385E | PubChem = 400772 | ChemSpiderID_Ref = | ChemSpiderID = 355164 | StdInChI_Ref = | StdInChI = 1S/C16H17BrClN3O3/c17-11-6-13-10(5-12(11)18)16(24)21(8-20-13)7-9(22)4-14-15(23)2-1-3-19-14/h5-6,8,14-15,19,23H,1-4,7H2/t14-,15+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = LVASCWIMLIKXLA-LSDHHAIUSA-N

| IUPAC_name = 7-Bromo-6-chloro-3-[3-[(2S,3R)-3-hydroxy-2-piperidinyl]-2-oxopropyl]-4-quinazolinone | C=16 | H=17 | Br=1 | Cl=1 | N=3 | O=3 | smiles = O=C(CN3C=NC2=CC(Br)=C(Cl)C=C2C3=O)C[C@@H]1NCCC[C@H]1O |drug_name=|alt=|caption=|type=|MedlinePlus=|licence_EU=|licence_US=}}

Halofuginone, sold under the brand name Halocur, is a coccidiostat used in veterinary medicine. It is a synthetic halogenated derivative of febrifugine, a natural quinazolinone alkaloid which can be found in the Chinese herb Dichroa febrifuga (Chang Shan). Collgard Biopharmaceuticals is developing halofuginone for the treatment of scleroderma and it has received orphan drug designation from the U.S. Food and Drug Administration.

Halofuginone inhibits the development of T helper 17 cells, immune cells that play an important role in autoimmune disease, but it does not affect other kinds of T cells which are involved in normal immune function. Halofuginone therefore has potential for the treatment of autoimmune disorders.

Halofuginone is also an inhibitor of collagen type I gene expression and as a consequence it may inhibit tumor cell growth.

References

References

  1. (29 October 1999). "Halocur EPAR".
  2. (9 November 1999). "Halocur PI".
  3. "Halofuginone hydrobromide". National Cancer Institute, National Institutes of Health, U.S. Department of Health and Human Services.
  4. (10 March 2000). "Halofuginone Receives FDA Orphan Drug Status For Scleroderma". WebCite.
  5. (June 2009). "Halofuginone inhibits TH17 cell differentiation by activating the amino acid starvation response". Science.
  6. (February 2012). "Halofuginone and other febrifugine derivatives inhibit prolyl-tRNA synthetase". Nature Chemical Biology.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

antiparasitic-agentsbromoareneschloroarenespiperidinessecondary-alcoholsquinazolinoneslactamsveterinary-drugs