TES (buffer)


title: "TES (buffer)" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["buffer-solutions", "sulfonic-acids", "primary-alcohols", "triols", "secondary-amines"] topic_path: "general/buffer-solutions" source: "https://en.wikipedia.org/wiki/TES_(buffer)" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 450878947 | ImageFile = TES free acid.svg | ImageSize = | ImageAlt = | Name = TES | PIN = 2-{[1,3-Dihydroxy-2-(hydroxymethyl)propan-2-yl]amino}ethane-1-sulfonic acid | OtherNames = TES free acid |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 7365-44-8 | CASNo2 = 70331-82-7 | CASNo2_Comment = (sodium salt) | UNII_Ref = | UNII = L173DK6289 | PubChem = 6992013 | ChemSpiderID_Ref = | ChemSpiderID = 73842 | SMILES = C(CS(=O)(=O)O)NC(CO)(CO)CO | InChI = 1/C6H15NO6S/c8-3-6(4-9,5-10)7-1-2-14(11,12)13/h7-10H,1-5H2,(H,11,12,13) | InChIKey = JOCBASBOOFNAJA-UHFFFAOYAR | StdInChI_Ref = | StdInChI = 1S/C6H15NO6S/c8-3-6(4-9,5-10)7-1-2-14(11,12)13/h7-10H,1-5H2,(H,11,12,13) | StdInChIKey_Ref = | StdInChIKey = JOCBASBOOFNAJA-UHFFFAOYSA-N}} |Section2={{Chembox Properties | Formula = C6H15NO6S | MolarMass = 229.25 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} TES is used to make buffer solutions. It has a pKa value of 7.550 (I=0, 25°C). It is one of the Good's buffers and can be used to make buffer solutions in the pH range 6.8–8.2. It is one of the components of Test yolk buffer medium used for refrigeration and transport of semen.

References

References

  1. Goldberg, R.. (2002). "Thermodynamic Quantities for the Ionization Reactions of Buffers". J. Phys. Chem. Ref. Data.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

buffer-solutionssulfonic-acidsprimary-alcoholstriolssecondary-amines