TAPS (buffer)

title: "TAPS (buffer)" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["buffer-solutions", "sulfonic-acids", "triols"] topic_path: "general/buffer-solutions" source: "https://en.wikipedia.org/wiki/TAPS_(buffer)" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Name = TAPS | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 449646540 | ImageFile = TAPS.svg | ImageSize = | ImageAlt = | PIN = 3-{[1,3-Dihydroxy-2-(hydroxymethyl)propan-2-yl]amino}propane-1-sulfonic acid | OtherNames = N-Tris(hydroxymethyl)methyl-3-aminopropanesulfonic acid |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 29915-38-6 | UNII_Ref = | UNII = Y5DC3IN066 | PubChem = 121591 | ChemSpiderID_Ref = | ChemSpiderID = 108495 | SMILES = C(CNC(CO)(CO)CO)CS(=O)(=O)O | InChI = 1/C7H17NO6S/c9-4-7(5-10,6-11)8-2-1-3-15(12,13)14/h8-11H,1-6H2,(H,12,13,14) | InChIKey = YNLCVAQJIKOXER-UHFFFAOYAP | StdInChI_Ref = | StdInChI = 1S/C7H17NO6S/c9-4-7(5-10,6-11)8-2-1-3-15(12,13)14/h8-11H,1-6H2,(H,12,13,14) | StdInChIKey_Ref = | StdInChIKey = YNLCVAQJIKOXER-UHFFFAOYSA-N}} |Section2={{Chembox Properties | C=7 | H=17 | N=1 | O=6 | S=1 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =
TAPS ([tris(hydroxymethyl)methylamino]propanesulfonic acid) is a chemical compound commonly used to make buffer solutions.
It can bind divalent cations, including Co(II) and Ni(II).
TAPS is effective to make buffer solutions in the pH range 7.7–9.1, since it has a pKa value of 8.44 (ionic strength I = 0, 25 °C).
The pH (and pKa at I ≠ 0) of the buffer solution changes with concentration and temperature, and this effect may be predicted e.g. using online calculators.
References
References
- (2008). "Complexation of M–(buffer)''x''–(OH)''y'' systems involving divalent ions (cobalt or nickel) and zwitterionic biological buffers (AMPSO, DIPSO, TAPS and TAPSO) in aqueous solution". [[J. Solution Chem.]].
- (2002). "Thermodynamic quantities for the ionization reactions of buffers". [[J. Phys. Chem. Ref. Data]].
- "Biological buffers". REACH Devices.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::