Terpyridine


title: "Terpyridine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["chelating-agents", "pyridines", "heterocyclic-compounds-with-3-rings"] topic_path: "general/chelating-agents" source: "https://en.wikipedia.org/wiki/Terpyridine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Watchedfields = changed | verifiedrevid = 470602628 | ImageFile = Terpyridine.svgclass=skin-invert | ImageSize = | PIN = 12,22:26,32-Terpyridine | OtherNames = 2,6-Bis(2-pyridyl)pyridine, Tripyridyl, 2,2:6,2-Terpyridine |Section1={{Chembox Identifiers | InChI = 1/C15H11N3/c1-3-10-16-12(6-1)14-8-5-9-15(18-14)13-7-2-4-11-17-13/h1-11H | InChIKey = DRGAZIDRYFYHIJ-UHFFFAOYAP | ChEMBL_Ref = | ChEMBL = 89445 | StdInChI_Ref = | StdInChI =1S/C15H11N3/c1-3-10-16-12(6-1)14-8-5-9-15(18-14)13-7-2-4-11-17-13/h1-11H | StdInChIKey_Ref = | StdInChIKey = DRGAZIDRYFYHIJ-UHFFFAOYSA-N | CASNo_Ref = | CASNo = 1148-79-4 | UNII_Ref = | UNII = G5E357ISH5 | PubChem = 70848 | ChemSpiderID_Ref = | ChemSpiderID = 64012 | ChEBI_Ref = | ChEBI = 245199 | SMILES = c1ccnc(c1)c2cccc(n2)c3ccccn3 |Section2={{Chembox Properties | C=15 | H=11 | N=3 | Appearance = white solid | Density = | MeltingPtC = 88 | BoilingPtC = 370 | BoilingPt_ref = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = Terpyridine (2,2';6',2"-terpyridine, often abbreviated to Terpy or Tpy) is a heterocyclic compound derived from pyridine. It is a white solid that is soluble in most organic solvents. The compound is mainly used as a ligand in coordination chemistry.

Synthesis

Terpyridine was first synthesized by G. Morgan and F. H. Burstall in 1932 by the oxidative coupling of pyridines. This method, however, proceeded in low yields. More efficient syntheses have since been described, mainly starting from 2-acetylpyridine. One method produces an enaminone by the reaction of 2-acetylpyridine with N,N-dimethylformamide dimethyl acetal. The base-catalyzed reaction of 2-acetylpyridine with carbon disulfide followed by alkylation with methyl iodide gives C5H4NCOCH=C(SMe)2. Condensation of this species with 2-acetylpyridine forms the related 1,5-diketone, which condenses with ammonium acetate to form a terpyridine. Treatment of this derivative with Raney nickel removes the thioether group.

Other methods have been developed for the synthesis of terpyridine and its substituted derivatives. Substituted terpyridines are also synthesized from palladium-catalyzed cross-coupling reactions. It can be prepared from bis-triazinyl pyridine.

Properties

::figure[src="https://upload.wikimedia.org/wikipedia/commons/a/a3/TerpyRuCl3.svg" caption="[[(Terpyridine)ruthenium trichloride]] is a representative complex of terpyridine."] ::

Terpyridine is a tridentate ligand that binds metals at three meridional sites giving two adjacent 5-membered MN2C2 chelate rings. Terpyridine forms complexes with most transition metal ion as do other polypyridine compounds, such as 2,2'-bipyridine and 1,10-phenanthroline. Complexes containing two terpyridine complexes, i.e. [M(Terpy)2]n+ are common. They differ structurally from the related [M(Bipy)3]n+ complexes in being achiral.

Terpyridine complexes, like other polypyridine complexes, exhibit characteristic optical and electrochemical properties: metal-to-ligand charge transfer (MLCT) in the visible region, reversible reduction and oxidation, and fairly intense luminescence.

Because they are pi-acceptors, terpyridine and bipyridine tend to stabilize metals in lower oxidation states. For instance in acetonitrile solution, it is possible to generate the [M(Terpy)2]+ (M = Ni, Co).

Related compounds

References

References

  1. Lide, D. R.. (1998). "Handbook of Chemistry and Physics". CRC Press.
  2. (2004). "Recent developments in the supramolecular chemistry of terpyridine-metal complexes". Chem. Soc. Rev..
  3. (1998). "Inorganic Syntheses".
  4. Potts, K. T.; Ralli, P.; Theodoridis, G.; Winslow, P.. (1990). "2,2':6',2' - Terpyridine".
  5. Kamata, K., Suzuki, A., Nakai, Y., Nakazawa, H., "Catalytic Hydrosilylation of Alkenes by Iron Complexes Containing Terpyridine Derivatives as Ancillary Ligands", Organometallics 2012, 31, 3825. {{doi. 10.1021/om300279t
  6. (2004). "Principles of Mononucleating and Binucleating Ligand Design". Chemical Reviews.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

chelating-agentspyridinesheterocyclic-compounds-with-3-rings