Suriclone

Chemical compound


title: "Suriclone" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["carbamates", "chloroarenes", "cyclopyrrolones", "gabaa-receptor-positive-allosteric-modulators", "naphthyridines", "4-methylpiperazin-1-yl-compounds", "sedatives", "dithianes", "nitrogen-heterocycles", "sulfur-heterocycles", "heterocyclic-compounds-with-2-rings"] description: "Chemical compound" topic_path: "general/carbamates" source: "https://en.wikipedia.org/wiki/Suriclone" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 470475198 | IUPAC_name = [6-(7-chloro-1,8-naphthyridin-2-yl)-5-oxo-3,7-dihydro-2H-[1,4]dithiino[2,3-c]pyrrol-7-yl] 4-methylpiperazine-1-carboxylate | image = Suriclone.svg | image_class = skin-invert-image | width = 200

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = 53813-83-5 | ATC_prefix = none | ATC_suffix = | PubChem = 40903 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 37353 | UNII_Ref = | UNII = LNC9G689VR | KEGG_Ref = | KEGG = | ChEBI_Ref = | ChEBI = | ChEMBL_Ref = | ChEMBL = 2105561

| C=20 | H=20 | Cl=1 | N=5 | O=3 | S=2 | smiles = Clc4nc5nc(N3C(=O)C=1SCCSC=1C3OC(=O)N2CCN(C)CC2)ccc5cc4 | StdInChI_Ref = | StdInChI = 1S/C20H20ClN5O3S2/c1-24-6-8-25(9-7-24)20(28)29-19-16-15(30-10-11-31-16)18(27)26(19)14-5-3-12-2-4-13(21)22-17(12)23-14/h2-5,19H,6-11H2,1H3 | StdInChIKey_Ref = | StdInChIKey = RMXOUBDDDQUBKD-UHFFFAOYSA-N Suriclone (Suril) is a sedative and anxiolytic drug in the cyclopyrrolone family of drugs. Other cyclopyrrolone drugs include zopiclone and pagoclone.

Suriclone has a very similar pharmacological profile to the benzodiazepine family of drugs including sedative and anxiolytic properties but with less amnestic effects, and its chemical structure is quite different from that of the benzodiazepine drugs.

The mechanism of action by which suriclone produces its sedative and anxiolytic effects is by modulating GABAA receptors, although suriclone is more subtype-selective than most benzodiazepines.

References

References

  1. (1992). "The effects of acute and repeated doses of suriclone on subjective sleep, psychomotor performance and cognitive function in young and elderly volunteers". Fundamental & Clinical Pharmacology.
  2. (February 1994). "Pharmacokinetic and -dynamic studies with a new anxiolytic, suriclone, utilizing EEG mapping and psychometry". British Journal of Clinical Pharmacology.
  3. (March 1983). "Suriclone: a new cyclopyrrolone derivative recognizing receptors labeled by benzodiazepines in rat hippocampus and cerebellum". Journal of Neurochemistry.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

carbamateschloroarenescyclopyrrolonesgabaa-receptor-positive-allosteric-modulatorsnaphthyridines4-methylpiperazin-1-yl-compoundssedativesdithianesnitrogen-heterocyclessulfur-heterocyclesheterocyclic-compounds-with-2-rings