Pentabamate

---

title: "Pentabamate" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["carbamates", "sedatives", "gabaa-receptor-positive-allosteric-modulators"] description: "Chemical compound" topic_path: "general/carbamates" source: "https://en.wikipedia.org/wiki/Pentabamate" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| IUPAC_name = 3-methylpentane-2,4-diyl dicarbamate | image = Pentabamate.svg | image_class = skin-invert-image | CAS_number = 5667-70-9 | ATC_prefix = None | ATC_suffix = | UNII = 8871ZB4UGC | PubChem = 3047822 | ChemSpiderID = 2310134 | C = 8 | H = 16 | N = 2 | O = 4 | smiles = O=C(OC(C(C(OC(=O)N)C)C)C)N | StdInChI = 1S/C8H16N2O4/c1-4(5(2)13-7(9)11)6(3)14-8(10)12/h4-6H,1-3H3,(H2,9,11)(H2,10,12) | StdInChIKey = XAIVVICFVUFHEP-UHFFFAOYSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | legal_status = | routes_of_administration =

Pentabamate (S-109) is a tranquilizer of the carbamate family.

References

References

1. (1970). "Carbamic acid esters of glycols". Bulletin of the World Health Organization.
2. World Health Organization. (2004). "The use of stems in the selection of International Nonproprietary Names (INN) for pharmaceutical substance".
3. (2018). "Drugs: Synonyms and Properties". Routledge Revivals.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::