Rosoxacin

Antibiotic


title: "Rosoxacin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["quinolone-antibiotics", "4-pyridyl-compounds", "carboxylic-acids"] description: "Antibiotic" topic_path: "general/quinolone-antibiotics" source: "https://en.wikipedia.org/wiki/Rosoxacin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Antibiotic ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 386256471 | IUPAC_name = 1-Ethyl-4-oxo-7-pyridin-4-ylquinoline-3-carboxylic acid | image = Rosoxacin.svg | image_class = skin-invert-image | tradename = Eradacil | Drugs.com = | pregnancy_AU = | pregnancy_US = | legal_UK = | legal_US = | routes_of_administration = | bioavailability = | protein_bound = | elimination_half-life = | excretion = | CAS_number_Ref = | CAS_number = 40034-42-2 | ATC_prefix = J01 | ATC_suffix = MB01 | PubChem = 287180 | DrugBank_Ref = | DrugBank = DB00817 | ChemSpiderID_Ref = | ChemSpiderID = 253208 | UNII_Ref = | UNII = 3Y1OT3J4NW | KEGG_Ref = | KEGG = D02305 | ChEBI_Ref = | ChEBI = 131715 | ChEMBL_Ref = | ChEMBL = 291157 | C=17 | H=14 | N=2 | O=3 | melting_point = 290 | smiles = CCn1cc(C(=O)O)c(=O)c2ccc(-c3ccncc3)cc21 | StdInChI_Ref = | StdInChI = 1S/C17H14N2O3/c1-2-19-10-14(17(21)22)16(20)13-4-3-12(9-15(13)19)11-5-7-18-8-6-11/h3-10H,2H2,1H3,(H,21,22) | StdInChIKey_Ref = | StdInChIKey = XBPZXDSZHPDXQU-UHFFFAOYSA-N

Rosoxacin (also known as acrosoxacin, tradename Eradacil) is a quinolone antibiotic indicated for the treatment of urinary tract infections and certain sexually transmitted diseases. Rosoxacin is not available in the United States.

It was developed in 1978 by George Lesher and his colleagues at Winthrop-Stearns (now part of sanofi-aventis), as an extension of the work that originally led to nalidixic acid.

It is classified as a first generation quinolone.

Synthesis

::figure[src="https://upload.wikimedia.org/wikipedia/commons/e/e5/Rosoxacin_synthesis.svg" caption="assign1 = STWB Inc. }}; Chem. Abstr., 84, 43880p (1975)."] ::

The synthesis of rosoxacin begins with a modified Hantzsch pyridine synthesis employing as component parts ammonium acetate, two equivalents of methyl propiolate, and one of 3-nitrobenzaldehyde. Oxidation of the resulting dihydropyridine (2) with nitric acid followed by saponification, decarboxylation, and reduction of the nitro group with iron and HCl acid gives aniline 3. This undergoes the classic sequence of Gould-Jacobs reaction with methoxymethylenemalonate ester to form the 4-hydroxyquinoline ring, and then alkylation with ethyl iodide and saponification of the ester to complete the synthesis of the antibacterial agent rosoxacin (4).

References

References

  1. (1984). "1-Ethyl-1,4-dihydro-4-oxo-7-(pyridinyl)-3-quinolinecarboxylic acids. I. Synthesis of 3- and 4-(3-aminophenyl)pyridine intermediates". Journal of Heterocyclic Chemistry.
  2. (1984). "1-Ethyl-1,4-dihydro-4-oxo-7-(pyridinyl)-3-quinolinecarboxylic acids. II. Synthesis". Journal of Heterocyclic Chemistry.
  3. (1990). "Demonstration of quinolone phototoxicity in vitro". Dermatologica.
  4. "1,4-Dihydro-4-oxo-7-pyridyl-3-quinolinecarboxylic acid derivatives".

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

quinolone-antibiotics4-pyridyl-compoundscarboxylic-acids