Methyl propiolate
Methyl propiolate is an organic compound with the formula HC2CO2CH3. It is the methyl ester of propiolic acid, the simplest acetylenic carboxylic acid. It is a colorless liquid that is miscible with organic solvents. The compound is a reagent and building block for the synthesis of other organic compounds, reactions that exploit the electrophilicity of the alkyne group. For example it is a potent dienophile. It has been widely evaluated as a precursor to heterocycles. including 1,3-dipolar cycloadditions.
.mw-parser-output .ib-chembox{border-collapse:collapse;text-align:left}.mw-parser-output .ib-chembox td,.mw-parser-output .ib-chembox th{border:1px solid #a2a9b1;width:40%}.mw-parser-output .ib-chembox td+td{width:60%}@media screen{html.skin-theme-clientpref-night .mw-parser-output .ib-chembox figure:not(.skin-invert-image):not(.skin-invert):not(.bg-transparent){background:var(--background-color-inverted,#f8f9fa)}}@media screen and (prefers-color-scheme:dark){html.skin-theme-clientpref-os .mw-parser-output .ib-chembox figure:not(.skin-invert-image):not(.skin-invert):not(.bg-transparent){background:var(--background-color-inverted,#f8f9fa)}}
| Column 1 | Column 2 |
|---|---|
| Preferred IUPAC name | |
| Methyl prop-2-ynoate | |
| Other names | |
| methyl propynoatemethyl acetylenecarboxylate | |
| CAS Number | .mw-parser-output .plainlist ol,.mw-parser-output .plainlist ul{line-height:inherit;list-style:none;margin:0;padding:0}.mw-parser-output .plainlist ol li,.mw-parser-output .plainlist ul li{margin-bottom:0}922-67-8 Y |
| 3D model (JSmol) | Interactive image |
| Beilstein Reference | 4-02-00-01688 |
| ChemSpider | 12948 |
| ECHA InfoCard | 100.011.894 |
| EC Number | 213-083-5 |
| PubChem CID | 13536 |
| UNII | T88NXO102K Y |
| CompTox Dashboard (EPA) | DTXSID60238923 |
| InChI | |
| InChI=1S/C4H4O2/c1-3-4(5)6-2/h1H,2H3Key: IMAKHNTVDGLIRY-UHFFFAOYSA-N | |
| SMILES | |
| COC(=O)C#C | |
| Chemical formula | C4H4O2 |
| Molar mass | 84.074 g·mol−1 |
| Appearance | colorless liquid |
| Density | 0.945 g mL−1 |
| Boiling point | 103–105 °C (217–221 °F; 376–378 K) |
| Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Infobox references | |
Methyl propiolate is an organic compound with the formula HC2CO2CH3. It is the methyl ester of propiolic acid, the simplest acetylenic carboxylic acid. It is a colorless liquid that is miscible with organic solvents. The compound is a reagent and building block for the synthesis of other organic compounds, reactions that exploit the electrophilicity of the alkyne group. For example it is a potent dienophile. It has been widely evaluated as a precursor to heterocycles. including 1,3-dipolar cycloadditions.