P7C3

Chemical compound
title: "P7C3" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["secondary-alcohols", "bromoarenes", "carbazoles", "nootropics"] description: "Chemical compound" topic_path: "general/secondary-alcohols" source: "https://en.wikipedia.org/wiki/P7C3" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
| Verifiedfields = changed | verifiedrevid = 451562732 | IUPAC_name = 1-anilino-3-(3,6-dibromocarbazol-9-yl)propan-2-ol | image = P7C3.svg | image_class = skin-invert-image | width = 250px
| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | excretion =
| CAS_number = 301353-96-8 | UNII_Ref = | UNII = 77ZWJ3QXR9 | ATC_prefix = | ATC_suffix = | PubChem = 2836187 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 2113543 | ChEMBL_Ref = | ChEMBL = 2442630
| C=21 | H=18 | Br=2 | N=2 | O=1 | smiles = c4ccccc4NCC(O)Cn2c1ccc(Br)cc1c(c3)c2ccc3Br | StdInChI_Ref = | StdInChI = 1S/C21H18Br2N2O/c22-14-6-8-20-18(10-14)19-11-15(23)7-9-21(19)25(20)13-17(26)12-24-16-4-2-1-3-5-16/h1-11,17,24,26H,12-13H2 | StdInChIKey_Ref = | StdInChIKey = FZHHRERIIVOATI-UHFFFAOYSA-N
P7C3 (pool 7, compound 3) is a drug related to latrepirdine (dimebon) which has neuroprotective and proneurogenic effects and may be potentially useful for the treatment of Alzheimer's disease and similar neurodegenerative disorders. The pharmacological effects of P7C3 in vitro resemble those of endogenous proneurogenic peptides such as fibroblast growth factor 1 (FGF-1), and the proneurogenic activity of P7C3 was around thirty times that of latrepirdine when they were compared in mice. P7C3 was chosen for further animal studies on the basis of favorable pharmacokinetic factors, such as its high oral bioavailability and long duration of action, but several other related compounds showed similar activity such as the more potent fluorinated analogue P7C3-A20 which is up to ten times stronger again, and the methoxy analogue P7C3-OMe, for which it was determined that the (R) enantiomer is the active form.
:{{multiple image | align = left | image1 = P7C3-A20.svg | caption1 = P7C3-A20 | image2 = P7C3-OMe.svg | caption2 = (R)-P7C3-OMe
The mechanism of action of the P7C3 series of compounds involves activation of nicotinamide phosphoribosyltransferase (NAMPT), the rate-limiting enzyme responsible for the transformation of nicotinamide into nicotinamide adenine dinucleotide (NAD). By activating NAMPT, the P7C3 compounds result in an increase in intracellular levels of NAD.
References
References
- (July 2010). "Discovery of a proneurogenic, neuroprotective chemical". Cell.
- (2014). "P7C3 neuroprotective chemicals function by activating the rate-limiting enzyme in NAD salvage". Cell.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::