Ciclesonide

---

title: "Ciclesonide" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["secondary-alcohols", "corticosteroid-cyclic-ketals", "glucocorticoids", "isobutyrate-esters", "enones", "drugs-developed-by-astrazeneca", "drugs-developed-by-takeda-pharmaceutical-company", "cyclohexyl-compounds"] description: "Chemical compound" topic_path: "general/secondary-alcohols" source: "https://en.wikipedia.org/wiki/Ciclesonide" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 460035585 | image = Ciclesonide.svg | image_class = skin-invert-image | alt = | image2 = Ciclesonide ball-and-stick from crystal.png | image_class2 = bg-transparent | alt2 =

| tradename = Omnaris, others | Drugs.com = | MedlinePlus = a607008 | pregnancy_AU = B3 | pregnancy_category = | routes_of_administration = Nasal inhalation | ATC_prefix = R01 | ATC_suffix = AD13 | ATC_supplemental =

| legal_AU = S4 | legal_UK = POM | legal_US = Rx-only | legal_US_comment = | legal_EU = Rx-only | legal_EU_comment = | legal_status =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| IUPHAR_ligand = 7469 | CAS_number_Ref = | CAS_number = 126544-47-6 | PubChem = 6918155 | DrugBank_Ref = | DrugBank = DB01410 | ChemSpiderID_Ref = | ChemSpiderID = 5293368 | UNII_Ref = | UNII = S59502J185 | KEGG_Ref = | KEGG = D01703 | ChEMBL_Ref = | ChEMBL = 1201164

| IUPAC_name = 2-[(1S, 2S, 4R, 8S, 9S,11S, 12S, 13R)-6-cyclohexyl-11-hydroxy-9, 13-dimethyl-16-oxo-5, 7-dioxapentacyclo [10.8.0.02,9.04, 8.013,18] icosa-14, 17-dien-8-yl]- 2-oxoethyl 2-methylpropanoate | C=32 | H=44 | O=7 | smiles = O=C(OCC(=O)[C@]25OC@@HC6CCCCC6)C(C)C | StdInChI_Ref = | StdInChI = 1S/C32H44O7/c1-18(2)28(36)37-17-25(35)32-26(38-29(39-32)19-8-6-5-7-9-19)15-23-22-11-10-20-14-21(33)12-13-30(20,3)27(22)24(34)16-31(23,32)4/h12-14,18-19,22-24,26-27,29,34H,5-11,15-17H2,1-4H3/t22-,23-,24-,26+,27+,29+,30-,31-,32+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = LUKZNWIVRBCLON-GXOBDPJESA-N | synonyms = (11β, 16α)-16, 17-[[(R)-cyclohexylmethylene]bis(oxy)]-11-hydroxy-21- (2-methyl-1-oxopropoxy)- pregna-1, 4-diene-3, 20-dione

Ciclesonide, sold under the brand name Omnaris among others, is a glucocorticoid used to treat asthma and allergic rhinitis.

Side effects of the medication include headache, nosebleeds, and inflammation of the nose and throat linings.

It was patented in 1990 and approved for medical use in 2005. The drug was approved for adults and children 12 and over by the US Food and Drug Administration in October 2006. It is on the World Health Organization's List of Essential Medicines.

Society and culture

Brand names

It is marketed under the brand names Alvesco for asthma and Omnaris, Omniair, Zetonna, and Alvesco for hay fever in the US and Canada.

References

References

1. (8 November 2022). "Omnaris- ciclesonide spray".
2. (16 February 2023). "Alvesco- ciclesonide aerosol, metered".
3. (16 February 2023). "Zetonna- ciclesonide aerosol, metered".
4. (16 September 2021). "Aservo Equihaler- ciclesonide spray, metered".
5. (28 February 2020). "Aservo Equihaler EPAR".
6. (May 2007). "The role of esterases in the metabolism of ciclesonide to desisobutyryl-ciclesonide in human tissue". Biochemical Pharmacology.
7. (2006). "Analogue-based Drug Discovery". John Wiley & Sons.
8. (23 October 2006). "FDA News Release. FDA Approves New Treatment for Allergies". [[Food and Drug Administration (United States).
9. (2021). "World Health Organization model list of essential medicines: 22nd list (2021)". World Health Organization.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::