Methylpropyltryptamine

---

title: "Methylpropyltryptamine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["n,n-dialkyltryptamines", "methyl-compounds", "propyl-compounds", "psychedelic-tryptamines", "tertiary-amines"] description: "Psychedelic drug" topic_path: "general/n-n-dialkyltryptamines" source: "https://en.wikipedia.org/wiki/Methylpropyltryptamine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Psychedelic drug ::

::data[format=table title="Infobox drug"]

Field	Value
image	Methylpropyltryptamine.svg
image_class	skin-invert-image
width	200px
image2	MPT 3D.png
image_class2	bg-transparent
width2	200px
class	Serotonergic psychedelic; Hallucinogen
ATC_prefix	None
CAS_number_Ref
CAS_number	850032-72-3
PubChem	74405270
ChemSpiderID	96351249
UNII_Ref
UNII	CWD3LY2N3Z
synonyms	MPT; N-Methyl-N-propyltryptamine
IUPAC_name	N-[2-(1H-indol-3-yl)ethyl]-N-methylpropan-1-amine
C	14
SMILES	CCCN(C)CCC1=CNC2=C1C=CC=C2
StdInChI	1S/C14H20N2/c1-3-9-16(2)10-8-12-11-15-14-7-5-4-6-13(12)14/h4-7,11,15H,3,8-10H2,1-2H3
StdInChIKey	SZUNESAKJQIJAC-UHFFFAOYSA-N
::

| drug_name = | image = Methylpropyltryptamine.svg | image_class = skin-invert-image | width = 200px | caption = | image2 = MPT 3D.png | image_class2 = bg-transparent | width2 = 200px

| pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = | class = Serotonergic psychedelic; Hallucinogen | ATC_prefix = None | ATC_suffix =

| legal_status =

| bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =

| CAS_number_Ref = | CAS_number = 850032-72-3 | CAS_supplemental = | PubChem = 74405270 | PubChemSubstance = | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 96351249 | UNII_Ref = | UNII = CWD3LY2N3Z | KEGG = | ChEBI = | ChEMBL = | NIAID_ChemDB = | PDB_ligand = | synonyms = MPT; N-Methyl-N-propyltryptamine

| IUPAC_name = N-[2-(1H-indol-3-yl)ethyl]-N-methylpropan-1-amine | C=14 | H=20 | N=2 | SMILES = CCCN(C)CCC1=CNC2=C1C=CC=C2 | StdInChI = 1S/C14H20N2/c1-3-9-16(2)10-8-12-11-15-14-7-5-4-6-13(12)14/h4-7,11,15H,3,8-10H2,1-2H3 | StdInChIKey = SZUNESAKJQIJAC-UHFFFAOYSA-N

Methylpropyltryptamine (MPT), also known as N-methyl-N-propyltryptamine, is a psychedelic drug of the tryptamine family. It is a homologue of methylethyltryptamine (MET).

Use and effects

In his book TiHKAL (Tryptamines I Have Known and Loved), Alexander Shulgin described MPT's effects as being unknown and its dose as being greater than 50mg orally.

Interactions

Chemistry

Detection

An analytical method for MPT's detection has been reported.

Crystal structure

In 2019, Chadeayne et al. published the crystal structure of MPT. The authors describe the structure as "...a single molecule in the asymmetric unit, with an indole group that demonstrates a mean deviation from planarity of 0.015 A°."

Analogues

Analogues of MPT include 4-HO-MPT, 5-MeO-MPT, methylethyltryptamine (MET), ethylpropyltryptamine (EPT), ethylisopropyltryptamine (EiPT), and dipropyltryptamine (DPT), among others.

Society and culture

Legal status

Canada

MPT is not a controlled substance in Canada as of 2025.

United States

MPT is not an explicitly controlled substance in the United States. However, it is an isomer of diethyltryptamine (DET), which is a schedule I controlled substance in this country, and so may be considered a controlled substance in the United States similarly.

References

References

1. {{CiteTiHKAL
2. (September 2005). "Analytical chemistry of synthetic routes to psychoactive tryptamines. Part III. Characterisation of the Speeter and Anthony route to N,N-dialkylated tryptamines using CI-IT-MS-MS". The Analyst.
3. (2019-07-28). "N -Methyl- N -propyltryptamine (MPT)". IUCrData.
4. "Controlled Drugs and Substances Act".
5. (January 2026). "Orange Book: List of Controlled Substances and Regulated Chemicals (January 2026)". U.S. [[Department of Justice]]: [[Drug Enforcement Administration]] (DEA): Diversion Control Division.
6. [[Drug Enforcement Administration]]. (3 December 2007). "Definition of “Positional Isomer” as It Pertains to the Control of Schedule I Controlled Substances".

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::