Ethylisopropyltryptamine

Chemical compound


title: "Ethylisopropyltryptamine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["designer-drugs", "n,n-dialkyltryptamines", "isopropylamino-compounds", "psychedelic-tryptamines", "tihkal"] description: "Chemical compound" topic_path: "general/designer-drugs" source: "https://en.wikipedia.org/wiki/Ethylisopropyltryptamine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| verifiedrevid = 447430848 | image = Ethylisopropyltryptamine.svg | image_class = skin-invert-image | width = 225px | image2 = EiPT 3D.png | image_class2 = bg-transparent | width2 = 200px

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | routes_of_administration = Oral | class = Psychedelic drug; Serotonergic psychedelic

| legal_AU = | legal_CA = | legal_DE = NpSG | legal_UK = Class A | legal_US = | legal_status =

| bioavailability = | protein_bound = | metabolism = | onset = | elimination_half-life = | duration_of_action = 4–6 hours | excretion =

| CAS_number_Ref = | CAS_number = 848130-11-0 | ATC_prefix = none | ATC_suffix = | PubChem = 44719455 | ChemSpiderID_Ref = | ChemSpiderID = 21106305 | UNII_Ref = | UNII = 63J8CXV5Z8 | synonyms = EiPT; N-Ethyl-N-isopropyltryptamine

| IUPAC_name = N-ethyl-N-[2-(1H-indol-3-yl)ethyl]propan-2-amine | C=15 | H=22 | N=2 | SMILES = CCN(C(C)C)CCc1c[nH]c2ccccc12 | StdInChI_Ref = | StdInChI = 1S/C15H22N2/c1-4-17(12(2)3)10-9-13-11-16-15-8-6-5-7-14(13)15/h5-8,11-12,16H,4,9-10H2,1-3H3 | StdInChIKey_Ref = | StdInChIKey = HQZLBYMOYCJZRF-UHFFFAOYSA-N

| melting_point = 71 | melting_high = 73

Ethylisopropyltryptamine (EiPT), also known as N-ethyl-N-isopropyltryptamine, is a psychedelic drug of the tryptamine family. It is taken orally.

EiPT appears to have been first synthesized and described by Alexander Shulgin.

Use and effects

In his book TiHKAL (Tryptamines I Have Known and Loved), Alexander Shulgin lists the dose of EiPT as 24 to 40mg and its duration as 4 to 6hours. According to Shulgin, this compound tends to produce nausea, dysphoria, and other unpleasant side effects. It also seems to largely lack the hallucinatory and visual properties usually associated with psychedelic drugs.

Interactions

Chemistry

EiPT is short for N-ethyl-N-isopropyltryptamine. The full chemical name of this structure is N-ethyl-N-[2-(1H-indol-3-yl)ethyl]propan-2-amine. The compound is a substituted tryptamine, which all belong to a larger family of compounds known as indolethylamines.

Synthesis

The chemical synthesis of EiPT has been described.

Analogues

Analogues of EiPT include 4-HO-EiPT, 4-AcO-EiPT, 5-MeO-EiPT, methylisopropyltryptamine (MiPT), propylisopropyltryptamine (PiPT), ethylpropyltryptamine (EPT), diethyltryptamine (DET), and diisopropyltryptamine (DiPT), among others.

Society and culture

Legal status

United States

EiPT is unscheduled and uncontrolled in the United States, but possession and sales of EiPT could be prosecuted under the Federal Analog Act because of its structural similarities to DET.

References

References

  1. {{CiteTiHKAL https://www.erowid.org/library/books_online/tihkal/tihkal10.shtml

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

designer-drugsn,n-dialkyltryptaminesisopropylamino-compoundspsychedelic-tryptaminestihkal