Levophenacylmorphan

---

title: "Levophenacylmorphan" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["ketones", "morphinans", "mu-opioid-receptor-agonists", "hydroxyarenes", "synthetic-opioids"] description: "Chemical compound" topic_path: "general/ketones" source: "https://en.wikipedia.org/wiki/Levophenacylmorphan" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 411037806 | IUPAC_name = (−)-3-Hydroxy-N-phenacylmorphinan | image = Levophenacylmorphan.svg | image_class = skin-invert-image | width = 150

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_BR = A1 | legal_BR_comment = | legal_CA = Schedule I | legal_UK = | legal_US = Schedule I | legal_DE = Anlage I | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = 10061-32-2 | ATC_prefix = none | ATC_suffix = | PubChem = 5362482 | DrugBank_Ref = | DrugBank = | UNII_Ref = | UNII = 7Q24AL2BR2 | ChemSpiderID_Ref = | ChemSpiderID = 16736786 | KEGG_Ref = | KEGG = D12687

| C=24 | H=27 | N=1 | O=2 | smiles = C1CC[C@@]23CCN(C@@HCC4=C3C=C(C=C4)O)CC(=O)C5=CC=CC=C5 | StdInChI_Ref = | StdInChI = 1S/C24H27NO2/c26-19-10-9-18-14-22-20-8-4-5-11-24(20,21(18)15-19)12-13-25(22)16-23(27)17-6-2-1-3-7-17/h1-3,6-7,9-10,15,20,22,26H,4-5,8,11-14,16H2/t20-,22+,24+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = RCYBMSQOSGJZLO-BGWNEDDSSA-N | synonyms = Levophenacylmorphan

Levophenacylmorphan is a morphinan derivative that acts as an opioid agonist. It has potent analgesic effects and is around 10x more potent than morphine. Adverse effects associated with its use are those of the opioids as a whole, including pruritus, nausea, respiratory depression, euphoria and development of tolerance and dependence to its effects.

References

References

1. Anvisa. (2023-03-31). "RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial". [[Diário Oficial da União]].
2. (February 1959). "A New Potent Synthetic Analgesic". The Journal of Organic Chemistry.
3. (January 1960). "Human pharmacology and addiction liabilities of phenazocine and levophenacylmorphan.". Bulletin on Narcotics.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::