Icatibant

Pharmaceutical drug


title: "Icatibant" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["anti-inflammatory-agents", "peptide-therapeutics", "orphan-drugs", "drugs-developed-by-takeda-pharmaceutical-company"] description: "Pharmaceutical drug" topic_path: "general/anti-inflammatory-agents" source: "https://en.wikipedia.org/wiki/Icatibant" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Pharmaceutical drug ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 461936569 | image = Icatibant.svg | image_class = skin-invert-image | width = 300 | alt = | caption =

| tradename = Firazyr | Drugs.com = | MedlinePlus = | DailyMedID = Icatibant | pregnancy_AU = C | pregnancy_category = | routes_of_administration = Subcutaneous | ATC_prefix = B06 | ATC_suffix = AC02 | ATC_supplemental =

| legal_AU = S4 | legal_AU_comment = | legal_CA = | legal_UK = | legal_US = Rx-only | legal_US_comment = | legal_EU = Rx-only | legal_EU_comment = | legal_status = Rx-only

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| index2_label = as salt | CAS_number_Ref = | CAS_number = 130308-48-4 | PubChem = 6918173 | IUPHAR_ligand = 667 | DrugBank_Ref = | DrugBank = DB06196 | ChemSpiderID_Ref = | ChemSpiderID = 16736634 | ChEBI_Ref = | ChEBI = 68556 | UNII_Ref = | UNII = 7PG89G35Q7 | KEGG2 = D04492 | ChEMBL_Ref = | ChEMBL = 1743581 | synonyms = Hoe 140, JE 049

| IUPAC_name = (2S)-2-[[(2S,3aS,7aS)-1-[(3R)-2-[(2S)-2-[[(2S)-2-[[2-[[(2S,4R)-1-[(2S)-1-[(2S)-2-[[(2R)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]-4-hydroxypyrrolidine-2-carbonyl]amino]acetyl]amino]-3-thiophen-2-ylpropanoyl]amino]-3-hydroxypropanoyl]-3,4-dihydro-1H-isoquinoline-3-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoic acid | C=59 | H=89 | N=19 | O=13 | S=1 | smiles = C1CC[C@H]2C@@HCC@HC(=O)NC@@HC(=O)O | StdInChI_Ref = | StdInChI = 1S/C59H89N19O13S/c60-37(14-5-19-67-57(61)62)48(82)72-38(15-6-20-68-58(63)64)52(86)75-22-8-18-43(75)54(88)77-30-35(80)26-44(77)50(84)70-28-47(81)71-40(27-36-13-9-23-92-36)49(83)74-41(31-79)53(87)76-29-34-12-2-1-10-32(34)24-46(76)55(89)78-42-17-4-3-11-33(42)25-45(78)51(85)73-39(56(90)91)16-7-21-69-59(65)66/h1-2,9-10,12-13,23,33,35,37-46,79-80H,3-8,11,14-22,24-31,60H2,(H,70,84)(H,71,81)(H,72,82)(H,73,85)(H,74,83)(H,90,91)(H4,61,62,67)(H4,63,64,68)(H4,65,66,69)/t33-,35+,37+,38-,39-,40-,41-,42-,43-,44-,45-,46+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = QURWXBZNHXJZBE-SKXRKSCCSA-N

Icatibant, sold under the brand name Firazyr, is a medication for the symptomatic treatment of acute attacks of hereditary angioedema (HAE) in adults with C1-esterase-inhibitor deficiency. It is not effective in angioedema caused by medication from the ACE inhibitor class.

It is a peptidomimetic consisting of ten amino acids, which is a selective and specific antagonist of bradykinin B2 receptors.

Mechanism of action

Bradykinin is a peptide-based hormone that is formed locally in tissues, very often in response to a trauma. It increases vessel permeability, dilates blood vessels and causes smooth muscle cells to contract. Bradykinin plays an important role as the mediator of pain. Surplus bradykinin is responsible for the typical symptoms of inflammation, such as swelling, redness, overheating and pain. These symptoms are mediated by activation of bradykinin B2 receptors. Icatibant acts as a bradykinin inhibitor by blocking the binding of native bradykinin to the bradykinin B2 receptor. Little is known about the effects of icatibant on the bradykinin B1 receptor.

Society and culture

Legal status

Icatibant received orphan drug status in Australia, the EU, Switzerland, and the US for the treatment of hereditary angioedema (HAE).

In the EU, the approval by the European Commission (July 2008) allows Jerini to market Firazyr in the European Union's 27 member states, as well as Switzerland, Liechtenstein and Iceland, making it the first product to be approved in all EU countries for the treatment of hereditary angioedema. In the US, the drug was granted FDA approval in August 2011.

References

References

  1. https://www.tga.gov.au/resources/prescription-medicines-registrations/icatibant-wkt-wockhardt-bio-pty-ltd
  2. (2004). "Icatibant: HOE 140, JE 049, JE049". Drugs in R&D.
  3. (2008-07-15). "Jerini Receives European Commission Approval for Firazyr (Icatibant) in the Treatment of HAE". [[Jerini.
  4. (16 December 2019). "Firazyr- icatibant acetate injection, solution".
  5. (17 September 2018). "Firazyr EPAR".
  6. (September–October 2017). "Randomized Trial of Icatibant for Angiotensin-Converting Enzyme Inhibitor-Induced Upper Airway Angioedema". The Journal of Allergy and Clinical Immunology. In Practice.
  7. (September 2010). "Management of acute attacks of hereditary angioedema: potential role of icatibant". Vascular Health and Risk Management.
  8. "FDA Approves Shire's Firazyr (icatibant injection) for Acute Attacks of Hereditary Angioedema (HAE)". Shire.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

anti-inflammatory-agentspeptide-therapeuticsorphan-drugsdrugs-developed-by-takeda-pharmaceutical-company