Bufexamac
Chemical compound
title: "Bufexamac" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["anti-inflammatory-agents", "hydroxamic-acids", "phenol-ethers", "withdrawn-drugs"] description: "Chemical compound" topic_path: "general/anti-inflammatory-agents" source: "https://en.wikipedia.org/wiki/Bufexamac" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
::data[format=table title="Infobox drug"]
| Field | Value |
|---|---|
| IUPAC_name | 2-(4-butoxyphenyl)-N-hydroxyacetamide |
| image | Bufexamac Structural Formula V2.svg |
| image_class | skin-invert-image |
| Drugs.com | |
| pregnancy_AU | |
| pregnancy_US | |
| legal_AU | |
| legal_CA | |
| legal_UK | |
| legal_US | |
| legal_status | OTC |
| routes_of_administration | Topical, rectal |
| excretion | Renal |
| IUPHAR_ligand | 7498 |
| CAS_number | 2438-72-4 |
| ATC_prefix | M01 |
| ATC_suffix | AB17 |
| ATC_supplemental | |
| PubChem | 2466 |
| ChEMBL | 94394 |
| ChemSpiderID | 2372 |
| UNII_Ref | |
| UNII | 4T3C38J78L |
| KEGG | D01271 |
| C | 12 |
| smiles | ONC(=O)Cc1ccc(OCCCC)cc1 |
| StdInChI | 1S/C12H17NO3/c1-2-3-8-16-11-6-4-10(5-7-11)9-12(14)13-15/h4-7,15H,2-3,8-9H2,1H3,(H,13,14) |
| StdInChIKey | MXJWRABVEGLYDG-UHFFFAOYSA-N |
| :: |
| IUPAC_name = 2-(4-butoxyphenyl)-N-hydroxyacetamide | image = Bufexamac Structural Formula V2.svg | image_class = skin-invert-image
| tradename = | Drugs.com = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = OTC | routes_of_administration = Topical, rectal
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = Renal
| IUPHAR_ligand = 7498
| CAS_number = 2438-72-4
| ATC_prefix = M01
| ATC_suffix = AB17
| ATC_supplemental =
| PubChem = 2466
| DrugBank =
| ChEMBL = 94394
| ChemSpiderID = 2372
| UNII_Ref =
| UNII = 4T3C38J78L
| KEGG = D01271
| C=12 | H=17 | N=1 | O=3 | smiles = ONC(=O)Cc1ccc(OCCCC)cc1 | StdInChI=1S/C12H17NO3/c1-2-3-8-16-11-6-4-10(5-7-11)9-12(14)13-15/h4-7,15H,2-3,8-9H2,1H3,(H,13,14) | StdInChIKey = MXJWRABVEGLYDG-UHFFFAOYSA-N
Bufexamac is a drug used as an anti-inflammatory agent on the skin, as well as rectally. Common brand names include Paraderm and Parfenac. It was withdrawn in Europe and Australia because of allergic reactions.
Indications
Ointments and lotions containing bufexamac are used for the treatment of subacute and chronic eczema of the skin, including atopic eczema, as well as sunburn and other minor burns, and itching. Suppositories containing bufexamac in combination with local anaesthetics are used against haemorrhoids.
Pharmacology
Bufexamac is thought to act by inhibiting the enzyme cyclooxygenase, which would make it a non-steroidal anti-inflammatory drug. Evidence on the mechanism of action is scarce. Furthermore, bufexamac was identified as a specific inhibitor of class IIB histone deacetylases (HDAC6 and HDAC10).
Side effects
Bufexamac can cause severe contact dermatitis which is often hard to distinguish from the initial condition. As a consequence, the European Medicines Agency recommended to withdraw the marketing approval in April 2010.
References
References
- (2020). "Bufexamac Safety advisory - risk of serious skin reactions". Therapeutic Goods Administration.
- (2010). "Arzneistoff-Profile". Govi Pharmazeutischer Verlag.
- (2000). "Dermatologische Externatherapie: Unter besonderer Berücksichtigung der Magistralrezeptur". Springer.
- (March 2011). "Chemoproteomics profiling of HDAC inhibitors reveals selective targeting of HDAC complexes". Nature Biotechnology.
- (2000). "Bufexamac: Ein Ekzemtherapeutikum, das selbst häufig allergische Kontaktekzeme hervorruft". Deutsches Ärzteblatt.
- (2010-04-22). "European Medicines Agency recommends revocation of marketing authorisations for bufexamac". European Medicines Agency.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::