Etazocine

Quality 0.50 · 1 view · Updated 2 months ago

Chemical compound

title: "Etazocine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["hydroxyarenes", "benzomorphans", "opioids"] description: "Chemical compound" topic_path: "general/hydroxyarenes" source: "https://en.wikipedia.org/wiki/Etazocine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| CAS_number_Ref = | CAS_number = 0135188AB | CAS_supplemental = 10286-45-0 ((−)-form (HCl)) | UNII_Ref = | UNII = 25Z262VU9E | IUPAC_name = 1,2,3,4,5,6-hexahydro-6,11-diethyl-3-methyl-2,6-methano-3-benzazocin-8-ol or 5,7-diethyl-2-hydroxy-2-methyl-6,7-benzomorphan | image = etazocine structure.svg | image_class = skin-invert-image | image2 = Etazocine-3D-balls-by-AHRLS-2012.png | image_class2 = bg-transparent | ATC_prefix = None | ATC_suffix = | PubChem = 187767 | ChemSpiderID = 163214 | C = 17 | H = 25 | N = 1 | O = 1 | smiles = Oc1ccc3c(c1)[C@@]2(C@HCC)CC | synonyms = NIH-7856 ((±)-form); GPA-208 ((−)-form); GPA-2087 ((−)-form); NIH-8178 ((−)-form); FDA-0487 ((−)-form) | StdInChI = 1S/C17H25NO/c1-4-14-16-10-12-6-7-13(19)11-15(12)17(14,5-2)8-9-18(16)3/h6-7,11,14,16,19H,4-5,8-10H2,1-3H3/t14-,16-,17-/m0/s1 | StdInChIKey = JYRBQCWXZNDERM-XIRDDKMYSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | legal_status = Non-regulated | routes_of_administration =

Etazocine (NIH-7856) is an opioid analgesic of the benzomorphan family which was never marketed. It acts as a partial agonist of the opioid receptors, with mixed agonist and antagonist effects. In animal studies, it was shown to induce analgesia, dependency, and respiratory depression, with overall effects similar to those of morphine, but with substantially reduced potency in comparison.

References

References

  1. (1969). "Bulletin, problems of drug dependence". National Academies.
  2. (December 1971). "The respiratory effects of a potent analgesic (GPA 2087) in man". British Journal of Anaesthesia.
  3. National Research Council (U.S.). Committee on Problems of Drug Dependence. (1970). "Report of the annual scientific meeting". National Research Council.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

hydroxyarenesbenzomorphansopioids