Cogazocine

---

title: "Cogazocine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["hydroxyarenes", "benzomorphans", "opioids", "cyclobutyl-compounds"] description: "Chemical compound" topic_path: "general/hydroxyarenes" source: "https://en.wikipedia.org/wiki/Cogazocine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| IUPAC_name = 3-(cyclobutylmethyl)-6-ethyl-11,11-dimethyl-1,2,3,4,5,6-hexahydro-2,6-methano-3-benzazocin-8-ol | image = Cogazocine.svg | image_class = skin-invert-image | image2 = Cogazocine-3D-balls-by-AHRLS-2012.png | image_class2 = bg-transparent | CAS_number = 57653-29-9 | ATC_prefix = None | ATC_suffix = | UNII = 6GKB767I3M | PubChem = 198576 | ChEMBL = 2104583 | ChemSpiderID = 171872 | C = 21 | H = 31 | N = 1 | O = 1 | smiles = Oc1ccc4c(c1)C2(C(C(N(CC2)CC3CCC3)C4)(C)C)CC | StdInChI = 1S/C21H31NO/c1-4-21-10-11-22(14-15-6-5-7-15)19(20(21,2)3)12-16-8-9-17(23)13-18(16)21/h8-9,13,15,19,23H,4-7,10-12,14H2,1-3H3 | StdInChIKey = IUUBFDSJJHOTDI-UHFFFAOYSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | legal_status = | routes_of_administration =

Cogazocine (INN) is an opioid analgesic of the benzomorphan family which was never marketed.

References

References

1. World Health Organization. (2004). "The use of stems in the selection of International Nonproprietary Names (INN) for pharmaceutical substance".
2. (1980). "Reversible suppression of spermiogenesis in beagle dogs following overdosage with the narcotic analgesic cogazocine lactate". Toxicology.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::