Cephaeline

Quality 0.50 · 1 view · Updated 2 months ago

title: "Cephaeline" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["hydroxyarenes", "norsalsolinol-ethers", "emetics", "drugs-with-no-legal-status", "tetrahydroisoquinoline-alkaloids"] topic_path: "general/hydroxyarenes" source: "https://en.wikipedia.org/wiki/Cephaeline" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| verifiedrevid = 708897244 | ImageFile = Cephaeline.svg | ImageClass = skin-invert-image | IUPACName = 7′,10,11-Trimethoxyemetan-6′-ol | SystematicName = (1R)-1-{[(2S,3R,11bS)-3-Ethyl-9,10-dimethoxy-1,3,4,6,7,11b-hexahydro-2H-pyrido[2,1-a]isoquinolin-2-yl]methyl}-7-methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol | OtherNames = Cepheline; Desmethylemetine; Dihydropsychotrine |Section1={{Chembox Identifiers | CASNo = 483-17-0 | CASNo_Ref = | ChEMBL = 255708 | ChEMBL_Ref = | PubChem = 442195 | KEGG_Ref = | KEGG = C09390 | UNII = QA971541A1 | UNII_Ref = | ChemSpiderID = 390702 | ChemSpiderID_Ref = | SMILES = CC[C@H]1CN2CCc3cc(c(cc3[C@@H]2C[C@@H]1C[C@@H]4c5cc(c(cc5CCN4)O)OC)OC)OC | StdInChI = 1S/C28H38N2O4/c1-5-17-16-30-9-7-19-13-27(33-3)28(34-4)15-22(19)24(30)11-20(17)10-23-21-14-26(32-2)25(31)12-18(21)6-8-29-23/h12-15,17,20,23-24,29,31H,5-11,16H2,1-4H3/t17-,20-,23+,24-/m0/s1 | StdInChI_Ref = | StdInChIKey = DTGZHCFJNDAHEN-OZEXIGSWSA-N | StdInChIKey_Ref = |Section2={{Chembox Properties | C=28 | H=38 | N=2 | O=4 | Appearance = White silky crystals | Density = | MeltingPt = | BoilingPt = | SolubleOther = Soluble | Solvent = ethanol |Section3={{Chembox Hazards | MainHazards = Emetic / poisonous | FlashPt = | AutoignitionPt =

Cephaeline is an alkaloid that is found in Cephaelis ipecacuanha and other plant species including Psychotria acuminata. Cephaeline induces vomiting by stimulating the stomach lining and is found in commercial products such as syrup of ipecac. Chemically, it is closely related to emetine.

Poison treatment

Cephaeline in the form of syrup of ipecac was once commonly recommended as an emergency treatment for accidental poisoning, but its use has been phased out due to its ineffectiveness.

References

References

  1. (July 1, 2003). "Micropropagacion de la planta medicinal psychotria acuminata". Agronomía Costarricense.
  2. (November 14, 2000). "Pharma Japan: Approval of 4 drugs including Seroquel recommended: CPAC panel.". Chemical Business Newsbase.
  3. (November 2003). "Policy statement: Poison treatment in the home". Pediatrics.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

hydroxyarenesnorsalsolinol-ethersemeticsdrugs-with-no-legal-statustetrahydroisoquinoline-alkaloids