Esuprone

title: "Esuprone" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["antidepressants", "phenyl-sulfonate-ethers", "coumarins"] topic_path: "general/antidepressants" source: "https://en.wikipedia.org/wiki/Esuprone" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 461095771 | ImageFile = Esuprone.svg | ImageClass = skin-invert-image | PIN = 3,4-Dimethyl-2-oxo-2H-1-benzopyran-7-yl ethanesulfonate | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 91406-11-0 | UNII_Ref = | UNII = K7EB9E48ZE | ChEMBL_Ref = | ChEMBL = 18504 | PubChem = 65827 | ChemSpiderID_Ref = | ChemSpiderID = 59239 | SMILES = O=S(=O)(Oc2ccc\1c(OC(=O)/C(=C/1C)C)c2)CC | InChI = 1/C13H14O5S/c1-4-19(15,16)18-10-5-6-11-8(2)9(3)13(14)17-12(11)7-10/h5-7H,4H2,1-3H3 | InChIKey = CHDGAVDQRSPBTA-UHFFFAOYAR | StdInChI_Ref = | StdInChI = 1S/C13H14O5S/c1-4-19(15,16)18-10-5-6-11-8(2)9(3)13(14)17-12(11)7-10/h5-7H,4H2,1-3H3 | StdInChIKey_Ref = | StdInChIKey = CHDGAVDQRSPBTA-UHFFFAOYSA-N |Section2={{Chembox Properties | Properties_ref = | C=13 | H=14 | O=5 | S=1 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =
Esuprone is an experimental drug candidate being investigated as an antidepressant. It acts as a monoamine oxidase A (MAO-A) inhibitor.
References
References
- Ganellin, C. R. (1996). "Dictionary of pharmacological agents". CRC Press.
- Vértes, Attila. (2003). "Handbook of nuclear chemistry". Springer.
- (1997). "MAO-A inhibition in brain after dosing with esuprone, moclobemide and placebo in healthy volunteers: In vivo studies with positron emission tomography". European Journal of Clinical Pharmacology.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::