Eptazocine

Quality 0.50 · 1 view · Updated 2 months ago

Opioid analgesic

title: "Eptazocine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["hydroxyarenes", "opioids"] description: "Opioid analgesic" topic_path: "general/hydroxyarenes" source: "https://en.wikipedia.org/wiki/Eptazocine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Opioid analgesic ::

| IUPAC_name = (1S,6S)-1,4-dimethyl-2,3,4,5,6,7-hexahydro-1H-1,6-methano-4-benzazonin-10-ol | image = Eptazocine.svg | image_class = skin-invert-image | alt = Skeletal formula | image2 = Eptazocine molecule ball.png | image_class2 = bg-transparent | alt2 = Ball-and-stick model | CAS_number = 72522-13-5 | CAS_supplemental = 72150-17-5 (bromide) | ATC_prefix = None | ATC_suffix = | UNII = 2208ZLI77S | PubChem = 3042090 | ChEMBL = 70566 | ChemSpiderID = 2305268 | C = 15 | H = 21 | N = 1 | O = 1 | smiles = Oc1ccc2c(c1)[C@@]3(CCN(CC@HC3)C)C | StdInChI = 1S/C15H21NO/c1-15-5-6-16(2)10-11(9-15)7-12-3-4-13(17)8-14(12)15/h3-4,8,11,17H,5-7,9-10H2,1-2H3/t11-,15-/m1/s1 | StdInChIKey = ZOWQTJXNFTWSCS-IAQYHMDHSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | legal_status = Rx-only | routes_of_administration = Oral

Eptazocine (Sedapain) is an opioid analgesic which was introduced in Japan by Morishita in 1987. It acts as a mixed κ-opioid receptor agonist and μ-opioid receptor antagonist.

References

References

  1. (2000). "Index nominum 2000: international drug directory". Taylor & Francis US.
  2. American Chemical Society. Division of Medicinal Chemistry. (1990). "Annual Reports in Medicinal Chemistry". Academic Press.
  3. (May 1985). "The interaction of eptazocine, a novel analgesic, with opioid receptors". Research Communications in Chemical Pathology and Pharmacology.
  4. (21 January 2011). "Chemistry of Opioids". Springer.
  5. (January 1990). "[Preferential action of eptazocine, a novel analgesic, with opioid receptors in isolated guinea pig ileum and mouse vas deferens preparations]". Nihon Yakurigaku Zasshi. Folia Pharmacologica Japonica.
  6. (1999). "Concise dictionary of pharmacological agents: properties and synonyms". Springer.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

hydroxyarenesopioids