EMDT

Quality 0.50 · 2 views · Updated 2 months ago

Chemical compound

title: "EMDT" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["2-alkyltryptamines", "5-ht6-agonists", "n,n-dialkyltryptamines", "dimethylamino-compounds", "5-methoxytryptamines"] description: "Chemical compound" topic_path: "general/2-alkyltryptamines" source: "https://en.wikipedia.org/wiki/EMDT" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | verifiedrevid = 424695163 | IUPAC_name = 2-(2-ethyl-5-methoxy-1H-indol-3-yl)-N,N-dimethylethanamine | image = EMDT structure.svg | image_class = skin-invert-image | width = 225px | image2 = EMDT 3D.png | image_class2 = bg-transparent | width2 = 200px

| tradename = | pregnancy_category = | legal_status = | routes_of_administration =

| bioavailability = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = 263744-72-5 | UNII_Ref = | UNII = GWM65988LJ | ATC_prefix = none | ATC_suffix = | PubChem = 6918513 | IUPHAR_ligand = 12 | ChemSpiderID_Ref = | ChemSpiderID = 5293710 | ChEMBL = 267615 | synonyms = 2-Ethyl-5-methoxy-N,N-dimethyltryptamine; 2-Ethyl-5-MeO-DMT; 2-Et-5-MeO-DMT

| C=15 | H=22 | N=2 | O=1 | SMILES = CCc2[nH]c1ccc(OC)cc1c2CCN(C)C | StdInChI_Ref = | StdInChI = 1S/C15H22N2O/c1-5-14-12(8-9-17(2)3)13-10-11(18-4)6-7-15(13)16-14/h6-7,10,16H,5,8-9H2,1-4H3 | StdInChIKey_Ref = | StdInChIKey = ZEYRDXUWJDGTLD-UHFFFAOYSA-N

2-Ethyl-5-methoxy-N,N-dimethyltryptamine (EMDT), also known as 2-ethyl-5-MeO-DMT, is a tryptamine derivative which is used in scientific research. It acts as a selective 5-HT6 receptor agonist, with a Ki of 16nM, and was one of the first selective agonists developed for this receptor. Its affinities for many other targets have also been reported. EMDT inhibits both short- and long-term memory formation in animal studies, and this effect can be reversed by the selective 5-HT6 antagonist SB-399,885. Additionally, it is active in the tail suspension test, suggesting that it could be an effective antidepressant.

References

References

  1. (March 2000). "2-Substituted tryptamines: agents with selectivity for 5-HT(6) serotonin receptors". Journal of Medicinal Chemistry.
  2. (February 2010). "Psychedelics and the human receptorome". PLOS ONE.
  3. (December 2008). "The effects of the 5-HT(6) receptor agonist EMD and the 5-HT(7) receptor agonist AS19 on memory formation". Behavioural Brain Research.
  4. (April 2007). "Biochemical and behavioral evidence for antidepressant-like effects of 5-HT6 receptor stimulation". The Journal of Neuroscience.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

2-alkyltryptamines5-ht6-agonistsn,n-dialkyltryptaminesdimethylamino-compounds5-methoxytryptamines