Dihydromorin

Quality 0.50 · 1 view · Updated 2 months ago

title: "Dihydromorin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["flavanonols", "resorcinols"] topic_path: "general/flavanonols" source: "https://en.wikipedia.org/wiki/Dihydromorin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 424669619 | Name = Dihydromorin | ImageFile = Dihydromorin.svg | ImageSize = 250px | IUPACName = (2R,3R)-2′,3,4′,5,7-Pentahydroxyflavan-4-one | SystematicName = (2R,3R)-2-(2,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 18422-83-8 | UNII_Ref = | UNII = BHC9FB8RFH | PubChem = 5458714 | ChemSpiderID_Ref = | ChemSpiderID = 4572618 | SMILES = C1=CC(=C(C=C1O)O)[C@@H]2C@HO | InChI = 1/C15H12O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,14-19,21H/t14-,15+/m0/s1 | InChIKey = QIWOFDHUQPJCJF-LSDHHAIUBR | StdInChI_Ref = | StdInChI = 1S/C15H12O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,14-19,21H/t14-,15+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = QIWOFDHUQPJCJF-LSDHHAIUSA-N |Section2={{Chembox Properties | Formula=C15H12O7 | MolarMass = 304.25 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = Dihydromorin is a flavanonol, a type of flavonoid. It can be found in plants of the family Moraceae including Morus nigra (Black mulberry), in Morus alba, Maclura pomifera (Maclura aurantiaca or Osage-Orange), in the jackfruit (Artocarpus heterophyllus) and in Artocarpus dadah.

Dihydromorin is an inhibitor of tyrosinase.

References

References

  1. [http://www.naturalstandard.com/index-abstract.asp?create-abstract=/monographs/herbssupplements/blackmulberry.asp Black mulberry on naturalstandard.com]
  2. [http://www.liberherbarum.com/In2837.HTM Dihydromorin on liberherbarum.com]
  3. (2009). "Chemical Components and Tyrosinase Inhibitors from the Twigs of Artocarpus heterophyllus". Journal of Agricultural and Food Chemistry.
  4. (2002). "Constituents of the bark and twigs of Artocarpus dadah with cyclooxygenase inhibitory activity". Journal of Natural Products.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

flavanonolsresorcinols