Pinobanksin

title: "Pinobanksin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["flavanonols", "flavonoid-antioxidants", "honey"] topic_path: "general/flavanonols" source: "https://en.wikipedia.org/wiki/Pinobanksin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 464207049 | ImageFile = Pinobanksin.svg | ImageClass = skin-invert-image | ImageSize = 250px | IUPACName = (2R,3R)-3,5,7-Trihydroxyflavan-4-one | SystematicName = (2R,3R)-3,5,7-Trihydroxy-2-phenyl-2,3-dihydro-4H-1-benzopyran-4-one | OtherNames = 3,5,7-trihydroxy-2-phenyl-2,3-dihydro-4H-chromen-4-one |Section1={{Chembox Identifiers | ChemSpiderID_Ref = | ChemSpiderID = 65962 | InChI = 1/C15H12O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,14-17,19H/t14-,15+/m0/s1 | InChIKey = SUYJZKRQHBQNCA-LSDHHAIUBG | StdInChI_Ref = | StdInChI = 1S/C15H12O5/c16-9-6-10(17)12-11(7-9)20-15(14(19)13(12)18)8-4-2-1-3-5-8/h1-7,14-17,19H/t14-,15+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = SUYJZKRQHBQNCA-LSDHHAIUSA-N | CASNo_Ref = | CASNo= 548-82-3 | UNII_Ref = | UNII = BK3ABR33DT | ChEBI_Ref = | ChEBI = 28103 | ChEMBL_Ref = | ChEMBL = 608410 | PubChem= 73202 | KEGG= C09826 | SMILES = O=C2c3c(OC@H[C@H]2O)cc(O)cc3O |Section2={{Chembox Properties | Formula=C15H12O5 | MolarMass= 272.25 g/mol | Appearance= | Density= 1.497 g/mL | MeltingPt= | BoilingPt= | Solubility= |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt =
Pinobanksin is an antioxidant bioflavonoid (specifically a flavanonol, a category of flavonol) that inhibits peroxidation of low density lipoprotein and it has electron donor properties reducing alpha-tocopherol radicals. It is present in sunflower honey.
Pinobanksin is biosynthesized from pinocembrin.
References
References
- (1992). "Identification of Flavonoids in Sunflower Honey". Journal of Food Science.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::