Brassicasterol

title: "Brassicasterol" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["cholestanes", "phytosterols"] topic_path: "general/cholestanes" source: "https://en.wikipedia.org/wiki/Brassicasterol" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 450506128 | Name = Brassicasterol | ImageFile = brassicasterol.svg | ImageSize = 210 | ImageName = Brassicasterol | ImageFile1 = Brassicasterol molecule ball.png | ImageSize1 = 260 | ImageAlt1 = Ball-and-stick model of brassicasterol | IUPACName = Ergosta-5,22-dien-3β-ol | SystematicName = (1R,3aS,3bS,7S,9aR,9bS,11aR)-1-[(2R,3E,4R)-5,6-Dimethylhept-3-en-2-yl]-9a,11a-dimethyl-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-7-ol | OtherNames = brassicasterol (3β,22E)-ergosta-5,22-dien-3-ol 24β-methylcholesta-5,22-dien-3 beta-ol 24-methyl cholest-5,22-dien-3β-ol |Section1={{Chembox Identifiers | UNII_Ref = | UNII = 2B0KG2XFOF | SMILES = O[C@@H]4C/C3=C/C[C@@H]1C@H[C@@]3(C)CC4 | ChemSpiderID_Ref = | ChemSpiderID = 4444704 | ChEBI = 3168 | InChI = 1/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-9,18-20,22-26,29H,10-17H2,1-6H3/b8-7+/t19-,20+,22-,23-,24+,25-,26-,27-,28+/m0/s1 | InChIKey = OILXMJHPFNGGTO-ZAUYPBDWBS | StdInChI_Ref = | StdInChI = 1S/C28H46O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-9,18-20,22-26,29H,10-17H2,1-6H3/b8-7+/t19-,20+,22-,23-,24+,25-,26-,27-,28+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = OILXMJHPFNGGTO-ZAUYPBDWSA-N | CASNo_Ref = | CASNo = 474-67-9 | PubChem = 6432458 |Section2={{Chembox Properties | C=28 | H=46 | O=1 | Appearance = White solid | Density = | Solubility = | MeltingPtC = 150 to 151 | MeltingPt_notes = | BoilingPt = |Section7={{Chembox Hazards | ExternalSDS = | MainHazards = | FlashPt = Non-flammable |Section8={{Chembox Related | OtherFunction_label = Sterols | OtherFunction = cholesterol β-sitosterol campesterol stigmasterol
Brassicasterol (24-methyl cholest-5,22-dien-3β-ol) is a 28-carbon sterol synthesised by several unicellular algae (phytoplankton) and some terrestrial plants, like rape. This compound has frequently been used as a biomarker for the presence of (marine) algal matter in the environment, and is one of the ingredients in stigmasterol-rich plant sterols (Number E499 in the European numbering system). There is some evidence to suggest that it may also be a relevant additional biomarker in Alzheimer's disease.
Chemical properties
Solubility
Brassicasterol has a low water solubility and, as a consequence, a high octanol-water partition coefficient. This means that, in most environmental systems, brassicasterol will be associated with the solid phase.
Degradation
In anaerobic sediments and soils, brassicasterol is stable for many hundreds of years, enabling it to be used as an indicator of past algal production (see below).
Chemical analysis
Since the molecule has a hydroxyl (-OH) group, it is frequently bound to other lipids including glycerols; most analytical methods, therefore, utilise a strong alkali (KOH or NaOH) to saponify the ester linkages. Typical extraction solvents include 6% KOH in methanol. The free sterols are then separated from the polar lipids by partitioning into a less polar solvent such as hexane. Prior to analysis, the hydroxyl group is frequently derivatised with BSTFA (bis-trimethyl silyl trifluoroacetamide) to replace the hydrogen with the less exchangeable trimethylsilyl (TMS) group. Instrumental analysis is frequently conducted on gas chromatograph (GC) with either a flame ionisation detector (FID) or mass spectrometer (MS). The mass spectrum for the TMS ether of brassicasterol can be seen in the figure.
::figure[src="https://upload.wikimedia.org/wikipedia/commons/d/de/mass_spectrum_brassicasterol.png" caption="date=June 2018}}"] ::
Formation and occurrences
It can be found in Mirabilis jalapa.
Algal sources
Brassicasterol is formed in plants from the isoprenoid squalene through campesterol as an intermediate. A list of the algae in which brassicasterol has been identified is shown below together with approximate composition.
::data[format=table title="Sterol content of selected [[dinoflagellates]] (as percentage). Data from Volkman, 1986"]
| Species | A | B | C | D | E | F | G | H | others |
|---|---|---|---|---|---|---|---|---|---|
| Gonyaulax spp | 100 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Peridinium foliaceum | 100 | 0 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Peridinium foliaceum | 80 | 20 | 0 | 0 | 0 | 0 | 0 | 0 | 0 |
| Gonyaulax diegensis | 39 | 0 | 0 | 0 | 0 | 0 | 0 | 29 | 32 |
| Pyrocystis lunula | 76 | 6 | 0 | 2 | 1 | 0 | 0 | 0 | 15 |
| Gonyaulax polygramma | 36 | 1 | 0 | 9 | 7 | 0 | 0 | 0 | 47 |
| Gymnodinium wilczeki | 26 | 39 | 0 | 35 | 1 | 0 | 0 | 0 | 0 |
| Glenodinium hallii | 8 | 50 | 0 | 0 | 0 | 42 | 0 | 0 | 0 |
| Noctiluca milaris | 0 | 1 | 1 | 5 | 73 | 0 | 6 | 0 | 14 |
| Gymnodinium simplex | 0 | 0 | 0 | 0 | 53 | 0 | 0 | 0 | 47 |
| Prorocentrum cordatum | 7 | 0 | 0 | 0 | 5 | 0 | 63 | 0 | 25 |
| :: |
:A = cholesterol :B = campesterol :C = sitosterol :D = 22-dehydrocholesterol ((22E)-cholesta-5,22-dien-3β-ol) :E = brassicasterol :F = stigmasterol :G = 24-methylene cholesterol :H = fucosterol
Use as a tracer for marine algae
The principal source of brassicasterol in the environment is from marine algae. Its relatively high concentration and stability allows it to be used in the assessment of the origin of organic matter in samples, especially sediments.
Brassicasterol / cholesterol ratio
::figure[src="https://upload.wikimedia.org/wikipedia/commons/b/b0/brassicasterol_cholesterol_ratio.png" caption="The concentration of brassicasterol down a sediment core from Loch Striven, Scotland together with it ratio to cholesterol"] ::
The concentration of brassicasterol in a core sample from Loch Striven, Scotland. Highest values may be seen in the top sections of the sediment, which decrease with depth. However, the cholesterol behaves in a similar manner, and the ratio brassicasterol/cholesterol is fairly uniform at all depths, indicating either a comparable degradation rate with no change in source or different degradation rates and a change in source.
Multivariate analysis
Multivariate statistical analyses such as principal component analysis of a range of lipid biomarkers (e.g., other sterols, fatty acids, and fatty alcohols) enable identification of compounds that have similar origins or behaviour. An example can be seen in the loadings plot for sediment samples from the Mawddach Estuary, Wales.
::figure[src="https://upload.wikimedia.org/wikipedia/commons/c/c4/brassicasterol_PCA.png" caption="Principal Component Analysis of several lipid biomarkers from the Mawddach Esturay - brassicasterol is highlighted in red]]
"]
::
The location of brassicasterol in this figure (shown in red) indicates that the distribution of this compound is similar to that of the short-chain fatty acids and alcohols, which are of marine origin. The terrestrially derived biomarkers such as β-sitosterol are on the opposite side of the figure and are mutually exclusive.
References
References
- (September 2011). "The plant sterol brassicasterol as additional CSF biomarker in Alzheimer's disease: Plant sterols as biomarker in AD". Acta Psychiatrica Scandinavica.
- link. (2014-01-04 ))
- Data from a review by Volkman, 1986{{clarify. (October 2010 )
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::