BSTFA

title: "BSTFA" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["trimethylsilyl-compounds"] topic_path: "general/trimethylsilyl-compounds" source: "https://en.wikipedia.org/wiki/BSTFA" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 453517835 | Name = BSTFA | ImageFileL1 = BSTFA-2D-skeletal-abbreviated.png | ImageAltL1 = Skeletal formula of BSTFA | ImageSizeL1 = 120 | ImageFileR1 = BSTFA-based-on-similar-xtals-3D-balls.png | ImageAltR1 = Ball-and-stick model of the BSTFA molecule | ImageSizeR1 = 120 | IUPACName = trimethylsilyl 2,2,2-trifluoro-N-trimethylsilylethanimidate | OtherNames = BSTFA, N,O-Bis(trimethylsilyl)trifluoroacetamide |Section1={{Chembox Identifiers | SMILES = CSi(C)O\C(\C(F)(F)F)=N[Si](C)(C)C | CASNo_Ref = | CASNo = 25561-30-2 | PubChem = 94358 | ChemSpiderID_Ref = | ChemSpiderID = 4518443 | ChEBI_Ref = | ChEBI = 85067 | InChI = 1/C8H18F3NOSi2/c1-14(2,3)12-7(8(9,10)11)13-15(4,5)6/h1-6H3/b12-7+ | InChIKey = XCOBLONWWXQEBS-KPKJPENVBV | StdInChI_Ref = | StdInChI = 1S/C8H18F3NOSi2/c1-14(2,3)12-7(8(9,10)11)13-15(4,5)6/h1-6H3/b12-7+ | StdInChIKey_Ref = | StdInChIKey = XCOBLONWWXQEBS-KPKJPENVSA-N |Section2={{Chembox Properties | C=8 | H=18 | F=3 | N=1 | O=1 | Si=2 | Appearance = colourless liquid | Density = 0.96 | Solubility = | MeltingPtC = -10 | MeltingPt_notes = | BoilingPtC = 45-55 | BoilingPt_notes = 14 mm Hg
N,O-Bis(trimethylsilyl)trifluoroacetamide (BSTFA) is an organosilicon compound. It is a colorless liquid that is very sensitive to traces of water or alcohols.
It is often used to convert hydroxyl groups to trimethylsilyl ether groups (Me = CH3): :
These silylated derivatives are amenable to analysis or further manipulation. Siloxanes are invariably more volatile than their hydroxyl precursors, and thus they can be more easily analyzed with gas chromatography.
This reagent was first reported in 1968.
Related compound
References
References
- (2001). "Encyclopedia of Reagents for Organic Synthesis".
- (May 1968). "A new silylation reagent for amino acids bis(trimethylsilyl)trifluoroacetamide (BSTFA)". Biochemical and Biophysical Research Communications.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::