Belinostat

Pharmaceutical drug
title: "Belinostat" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["acrylamides", "histone-deacetylase-inhibitors", "sulfonamides", "hydroxamic-acids"] description: "Pharmaceutical drug" topic_path: "general/acrylamides" source: "https://en.wikipedia.org/wiki/Belinostat" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Pharmaceutical drug ::
::data[format=table title="Infobox drug"]
| Field | Value |
|---|---|
| IUPAC_name | (2E)-N-Hydroxy-3-[3-(phenylsulfamoyl)phenyl]prop-2-enamide |
| image | Belinostat.svg |
| image_class | skin-invert-image |
| tradename | Beleodaq |
| Drugs.com | |
| pregnancy_AU | |
| pregnancy_US | D |
| legal_AU | |
| legal_CA | |
| legal_UK | |
| legal_US | Rx-only |
| routes_of_administration | Intravenous (IV) |
| bioavailability | 100% (IV) |
| protein_bound | 92.9–95.8% |
| metabolism | UGT1A1 |
| excretion | Urine |
| CAS_number | 866323-14-0 |
| CAS_number_Ref | |
| ATC_prefix | L01 |
| ATC_suffix | XH04 |
| PubChem | 6918638 |
| DrugBank | DB05015 |
| ChemSpiderID | 5293831 |
| ChemSpiderID_Ref | |
| UNII | F4H96P17NZ |
| UNII_Ref | |
| ChEMBL | 408513 |
| ChEMBL_Ref | |
| ChEBI | 61076 |
| ChEBI_Ref | |
| synonyms | PXD101 |
| KEGG | D08870 |
| C | 15 |
| smiles | O=S(=O)(Nc1ccccc1)c2cc(\C=C\C(=O)NO)ccc2 |
| StdInChI_Ref | |
| StdInChI | 1S/C15H14N2O4S/c18-15(16-19)10-9-12-5-4-8-14(11-12)22(20,21)17-13-6-2-1-3-7-13/h1-11,17,19H,(H,16,18)/b10-9+ |
| StdInChIKey_Ref | |
| StdInChIKey | NCNRHFGMJRPRSK-MDZDMXLPSA-N |
| :: |
| IUPAC_name = (2E)-N-Hydroxy-3-[3-(phenylsulfamoyl)phenyl]prop-2-enamide | image = Belinostat.svg | image_class = skin-invert-image | alt = | caption =
| tradename = Beleodaq | Drugs.com = | MedlinePlus = | pregnancy_AU = | pregnancy_US = D | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = Rx-only | legal_status = | routes_of_administration = Intravenous (IV)
| bioavailability = 100% (IV) | protein_bound = 92.9–95.8% | metabolism = UGT1A1 | onset = | elimination_half-life = | excretion = Urine
| CAS_number = 866323-14-0 | CAS_number_Ref = | ATCvet = | ATC_prefix = L01 | ATC_suffix = XH04 | PubChem = 6918638 | DrugBank = DB05015 | ChemSpiderID = 5293831 | ChemSpiderID_Ref = | UNII = F4H96P17NZ | UNII_Ref = | ChEMBL = 408513 | ChEMBL_Ref = | ChEBI = 61076 | ChEBI_Ref = | synonyms = PXD101 | KEGG = D08870
| C=15|H=14|N=2|O=4|S=1 | smiles = O=S(=O)(Nc1ccccc1)c2cc(\C=C\C(=O)NO)ccc2 | StdInChI_Ref = | StdInChI = 1S/C15H14N2O4S/c18-15(16-19)10-9-12-5-4-8-14(11-12)22(20,21)17-13-6-2-1-3-7-13/h1-11,17,19H,(H,16,18)/b10-9+ | StdInChIKey_Ref = | StdInChIKey = NCNRHFGMJRPRSK-MDZDMXLPSA-N
Belinostat (trade name Beleodaq, previously known as PXD101) is a histone deacetylase inhibitor drug developed by TopoTarget for the treatment of hematological malignancies and solid tumors.
It was approved in July 2014 by the US FDA to treat peripheral T-cell lymphoma.
In 2007 preliminary results were released from the Phase II clinical trial of intravenous belinostat in combination with carboplatin and paclitaxel for relapsed ovarian cancer. Final results in late 2009 of a phase II trial for T-cell lymphoma were encouraging. Belinostat has been granted orphan drug and fast track designation by the FDA, and was approved in the US for the use against peripheral T-cell lymphoma on 3 July 2014.{{cite news|url=https://www.fda.gov/NewsEvents/Newsroom/PressAnnouncements/ucm403929.htm|archive-url=https://web.archive.org/web/20140704015920/http://www.fda.gov/NewsEvents/Newsroom/PressAnnouncements/ucm403929.htm|url-status=dead|archive-date=July 4, 2014|publisher=FDA|title=FDA approves Beleodaq to treat rare, aggressive form of non-Hodgkin lymphoma |date=3 July 2014}} It is not approved in Europe .
The approved pharmaceutical formulation is given intravenously. Belinostat is primarily metabolized by UGT1A1; the initial dose should be reduced if the recipient is known to be homozygous for the UGT1A1*28 allele.
References
References
- "Beleodaq (belinostat) For Injection, For Intravenous Administration. Full Prescribing Information". Spectrum Pharmaceuticals, Inc. Irvine, CA 92618.
- (August 2003). "Pharmacodynamic response and inhibition of growth of human tumor xenografts by the novel histone deacetylase inhibitor PXD101". Molecular Cancer Therapeutics.
- (October 2007). "CuraGen Corporation (CRGN) and TopoTarget A/S Announce Presentation of Belinostat Clinical Trial Results at AACR-NCI-EORTC International Conference".
- (December 2009). "Final Results of a Phase II Trial of Belinostat (PXD101) in Patients with Recurrent or Refractory Peripheral or Cutaneous T-Cell Lymphoma".
- Carroll, John. (2 February 2010). "Spectrum adds to cancer pipeline with $350M deal.". Fierce Biotech.
- (4 August 2014). "Neue Wirkstoffe – Belinostat". Österreichische Apothekerzeitung.
- (2016). "Drug Information Handbook for Oncology". Wolters Kluwer.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::