Furylfuramide

title: "Furylfuramide" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["acrylamides", "carboxamides", "carcinogens", "iarc-group-2b-carcinogens", "nitrofurans", "toxicology", "suspected-fetotoxicants", "male-reproductive-toxicants"] topic_path: "general/acrylamides" source: "https://en.wikipedia.org/wiki/Furylfuramide" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Watchedfields = changed | verifiedrevid = 443829709 | ImageFile = Furylfuramide.svg | ImageSize = 225px | PIN = (2Z)-2-(Furan-2-yl)-3-(5-nitrofuran-2-yl)prop-2-enamide | OtherNames = (Z)-2-(2-Furyl)-3-(5-nitro-2-furyl)prop-2-enamide AF-2, Tofuron, Alpha-2-furyl-5-nitro-2-furanacrylamide,
2-(2-Furyl)-3-(5-nitro-2-furyl)acrylic acid amide,
a-(Furyl)-b-(5-nitro-2-furyl)acrylic amide,
trans-2-(2-Furyl)-3-(5-nitro-2-furyl)acrylamide,
2-(2-furyl)-3-(5-nitro-2-furyl) acrylamide,
2-Furanacetamide, alpha-((5-nitro-2-furanyl)methylene)-,
|Section1 = {{Chembox Identifiers | Abbreviations = AF-2, FF | ChemSpiderID_Ref = | ChemSpiderID = 4444292 | KEGG_Ref = | KEGG = D02528 | InChI = 1/C11H8N2O5/c12-11(14)8(9-2-1-5-17-9)6-7-3-4-10(18-7)13(15)16/h1-6H,(H2,12,14)/b8-6- | InChIKey = LYAHJFZLDZDIOH-VURMDHGXBB | ChEMBL_Ref = | ChEMBL = 259747 | StdInChI_Ref = | StdInChI = 1S/C11H8N2O5/c12-11(14)8(9-2-1-5-17-9)6-7-3-4-10(18-7)13(15)16/h1-6H,(H2,12,14)/b8-6- | StdInChIKey_Ref = | StdInChIKey = LYAHJFZLDZDIOH-VURMDHGXSA-N | CASNo_Ref = | CASNo=3688-53-7 | PubChem=5280707 | UNII_Ref = | UNII = 054NR2135Y | ChEBI_Ref = | ChEBI = 15660 | SMILES = O=N+c2oc(/C=C(/c1occc1)C(=O)N)cc2
| Section2 = {{Chembox Properties | Formula = C11H8N2O5 | MolarMass = 248.19162 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility =
|Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =
Furylfuramide (also known as AF-2) is a synthetic nitrofuran derivative which was widely used as a food preservative in Japan since at least 1965, but withdrawn from the market in 1974 when it was observed to be mutagenic to bacteria in vitro and thus suspected of carcinogenicity. This was confirmed later when animal testing | last = Hayatsu | first = Hiroka | author-link = | title = Mutagens in Food: Detection and Prevention | publisher = CRC Press | year = 1991 | location = | pages = 286 pages | url = https://books.google.com/books?id=eQyMCWRIVf4C&q=carcinogen+preservative+(furylfuramide%7Caf2)&pg=RA1-PA1 | isbn = 0-8493-5877-9 }} found it to cause benign and malignant tumors in the mammary glands, stomachs, esophagi, and lungs of rodents of both sexes, although insufficient evidence exists in human exposure. |title=IARC Monographs on the Evaluation of Carcinogenic Risks to Humans |publisher=World Health Organization, International Agency for Research on Cancer |date=1998-04-16 |volume=31 Some Food Additives, Feed Additives and Naturally Occurring Substances: Summary of Data Reported and Evaluation |url=http://monographs.iarc.fr/ENG/Monographs/vol31/volume31.pdf |url-status=dead |archiveurl=https://web.archive.org/web/20070929132025/http://monographs.iarc.fr/ENG/Monographs/vol31/volume31.pdf |archivedate=2007-09-29
This successful use of bacterial mutagenicity as a screen for carcinogenicity confirmed the use of this methodology as a rapid and efficient test, in comparison to animal testing alone, and led to its further development. The availability of such simpler tests in turn gave rise to greater government oversight and testing of compounds to which the public would be exposed. | last = Tazima | first = Y | author-link = | title = Consequences of the AF-2 incident in Japan | journal = Environmental Health Perspectives | publisher = Environmental Health Perspectives, Vol. 29 | date = April 1979 | pages = 183–87 | volume = 29 | edition = | doi = 10.2307/3429062 | id = | pmid = 389620 | pmc = 1637377 | jstor = 3429062 }}
References
References
- [http://cancerweb.ncl.ac.uk/cgi-bin/omd?furylfuramide On-Line Medical Dictionary]
- (1975). "Carcinogenicity of the food additive furylfuramide in foetal and young mice". Nature.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::