Altechromone A

Quality 0.50 · 0 views · Updated 2 months ago

title: "Altechromone A" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["chromones"] topic_path: "general/chromones" source: "https://en.wikipedia.org/wiki/Altechromone_A" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 456682023 | Reference = | ImageFile = Altechromone A.svg | PIN = 7-Hydroxy-2,5-dimethyl-4H-1-benzopyran-4-one | OtherNames = Altechromone A |Section1={{Chembox Identifiers | CASNo = 38412-47-4 | CASNo_Ref = | ChEMBL_Ref = | ChEMBL = 509319 | PubChem = 5316891 | ChemSpiderID_Ref = | ChemSpiderID = 4475859 | StdInChI_Ref = | StdInChI = 1S/C11H10O3/c1-6-3-8(12)5-10-11(6)9(13)4-7(2)14-10/h3-5,12H,1-2H3 | StdInChIKey_Ref = | StdInChIKey = CRNGFKXWIYTEPH-UHFFFAOYSA-N | SMILES = O=C\1c2c(O/C(=C/1)C)cc(O)cc2C |Section2={{Chembox Properties | C=11 | H=10 | O=3 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =

Altechromone A is a chromone derivative. To date, it has been isolated from plant families such as Polygonaceae, Lamiaceae, Fabaceae, and Hypericaceae.

Isolation

Altechromone A was isolated from an Alternaria sp. in 1992. It has since been isolated from fungi species such as Hypoxium trancatum, Ascomycota sp., and Alternaria brassicicola. Researchers have come to the conclusion that Altechromone A is a common fungal metabolite with its origin in endophytic fungi.

Potential uses

For thousands of years, humans have used endophytic species in traditional medicines. Since Louis Pasteur began investigating microbes, science has further revealed the potential benefits of these compounds. Researchers noted that this compound demonstrates both root growth promotion and inhibits bacterial production. Penicillin and other antibiotics effectively treated microbial infections. However, antibiotic misuse has resulted in resistance of pathogens to antimicrobial agents. Altechromone A could provide a source of antimicrobial agents that microbes have yet to develop a resistance to. In addition, the compound could possess anti-tumor capabilities thus yielding more potential medical applications.

References

References

  1. "2,5-Dimethyl-7-hydroxy chromone". Royal Society of Chemistry.
  2. Konigs, P.. (November 17, 2010). "Structural Revision and Synthesis of Altechromone A". Journal of Natural Products.
  3. Strobel, Gary. (December 2003). "Bioprospecting for Microbial Endophytes and Their Natural Products". Microbiology and Molecular Biology Reviews.
  4. Gu, Wen. (May 23, 2009). "Bioactive metabolites from ''Alternaria brassicicola'' ML-PO8, an endophytic funus residing in ''Malus halliana''". World J Microbiol Biotechnol.
  5. Gu, W.. (December 24, 2006). "Cytotoxic Benzo[j]fluoranthene Metabolites from ''Hypoxylon truncatum'' IFB-18, and Endophyte of ''Artemisia annua''". Journal of Natural Products.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

chromones