2-Ethylanthraquinone

Quality 0.50 · 2 views · Updated 2 months ago

Intermediate Chemical in H2O2 Synthesis

title: "2-Ethylanthraquinone" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["anthraquinones"] description: "Intermediate Chemical in H2O2 Synthesis" topic_path: "general/anthraquinones" source: "https://en.wikipedia.org/wiki/2-Ethylanthraquinone" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Intermediate Chemical in H2O2 Synthesis ::

| Verifiedfields = changed | verifiedrevid = 477213314 | Name = 2-Ethylanthraquinone | ImageFile = 2-Ethylanthraquinone.svg | ImageName = Structural formula of 2-Ethylanthraquinone | ImageSize = 250px | ImageFile1 = 2-Ethylanthraquinone-3D-balls.png | ImageName1 = Ball-and-stick model | ImageSize1 = 230px | PIN = 2-Ethylanthracene-9,10-dione | OtherNames = 2-Ethyl-9,10-anthracenedione | Section1 = {{Chembox Identifiers | ChemSpiderID_Ref = | ChemSpiderID = 6514 | PubChem = 6772 | UNII = 59YJ81QZKD | InChI = 1/C16H12O2/c1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h3-9H,2H2,1H3 | InChIKey = SJEBAWHUJDUKQK-UHFFFAOYAW | SMILES = O=C2c1c(cccc1)C(=O)c3c2ccc(c3)CC | ChEMBL_Ref = | ChEMBL = 42355 | StdInChI_Ref = | StdInChI = 1S/C16H12O2/c1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h3-9H,2H2,1H3 | StdInChIKey_Ref = | StdInChIKey = SJEBAWHUJDUKQK-UHFFFAOYSA-N | CASNo_Ref = | CASNo = 84-51-5 | EINECS = 201-535-4 | Section2 = {{Chembox Properties | Formula = C16H12O2 | MolarMass = 236.27 g/mol | MeltingPtC = 105 | BoilingPt = 415.4 @ 760mmHg | Density = 1.231g/cm3 | Appearance = white to yellowish crystals or powder | Section7 = {{Chembox Hazards | FlashPtC = 155.4 | GHSPictograms = | GHSSignalWord = Danger | HPhrases = | PPhrases =

2-Ethylanthraquinone is an organic compound that is a derivative of anthraquinone. This pale yellow solid is used in the industrial production of hydrogen peroxide (H2O2).

Production

2-Ethylanthraquinone is prepared from the reaction of phthalic anhydride and ethylbenzene: :C6H4(CO)2O + C6H5Et → C6H4(CO)2C6H3Et + H2O. Both phthalic anhydride and ethylbenzene are readily available, being otherwise used in the large-scale production of plastics.

Uses

Hydrogen peroxide is produced industrially by the anthraquinone process which involves using 2-alkyl-9,10-anthraquinones for hydrogenation. Many derivatives of anthraquinone are used but 2-ethylanthraquinone is common because of its high selectivity. The hydrogenation of the unsubstituted ring can reach 90% selectivity by using 2-ethylanthraquinone. Hydrogenation follows the Riedl-Pfleiderer, or autoxidation, process:

::figure[src="https://upload.wikimedia.org/wikipedia/commons/2/21/Riedl-Pfleiderer_process.svg" caption="left}}"] ::

The hydrogenation of 2-ethylanthraquinone is catalyzed by palladium. Hydrogenation produces both 2-ethylanthrahydroquinone and tetrahydroanthraquinone. The tetrahydro derivative of 2-alkylanthraquinone is easily hydrogenated but is more difficult to oxidize. The formation of the tetrahydro derivative can be suppressed through the selection of catalysts, solvents, and reaction conditions. Some suggested solvent mixtures are polyalkylated benzenes and alkyl phosphates or tetraalkyl ureas, trimethylbenzenes and alkylcyclohexanol esters, and methylnaphthalene and nonyl alcohols.

References

References

  1. (2007). "Hydrogen Peroxide". Wiley-VCH.
  2. Römpp CD 2006, Georg Thieme Verlag 2006

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

anthraquinones