Zenazocine

Opioid analgesic


title: "Zenazocine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["benzomorphans", "kappa-opioid-receptor-agonists", "ketones", "opioids", "hydroxyarenes"] description: "Opioid analgesic" topic_path: "general/benzomorphans" source: "https://en.wikipedia.org/wiki/Zenazocine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Opioid analgesic ::

| IUPAC_name = 1-[(1S,9R)-4-hydroxy-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-yl]-6-methyl-3-heptanone | image = Zenazocine structure.svg | image_class = skin-invert-image | image2 = Zenazocine-3D-balls-by-AHRLS-2012.png | image_class2 = bg-transparent | CAS_number = 74559-85-6 | UNII_Ref = | UNII = 8WIL6L9U01 | ATC_prefix = None | ATC_suffix = | PubChem = 9885108 | ChemSpiderID = 8060782 | C = 23 | H = 35 | N = 1 | O = 2 | smiles = O=C(CCC(C)C)CCC3([C@@H]2N(CC[C@]3(c1c(ccc(O)c1)C2)C)C)C | StdInChI = 1S/C23H35NO2/c1-16(2)6-8-18(25)10-11-23(4)21-14-17-7-9-19(26)15-20(17)22(23,3)12-13-24(21)5/h7,9,15-16,21,26H,6,8,10-14H2,1-5H3/t21-,22+,23?/m1/s1 | StdInChIKey = JZFZEWWOIOYBTQ-AXWGZAFASA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | legal_US = | legal_status = Non-regulated | routes_of_administration =

Zenazocine (INN; WIN-42,964) is an opioid analgesic of the benzomorphan family which made it to phase II clinical trials before development was ultimately halted and it was never marketed. It acts as a partial agonist of the μ- and δ-opioid receptors, with less intrinsic activity at the former receptor and more at the latter receptor (hence, it behaves more antagonistically at the former and more agonistically at the latter), and produces antinociceptive effects in animal studies.

References

References

  1. (February 1985). "Pharmacological profiles of tonazocine (Win 42156) and zenazocine (Win 42964)". Neuropeptides.
  2. (1985). "Annual Reports in Medicinal Chemistry". Academic Press.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

benzomorphanskappa-opioid-receptor-agonistsketonesopioidshydroxyarenes