Zebularine

title: "Zebularine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["nucleosides", "pyrimidones"] topic_path: "general/nucleosides" source: "https://en.wikipedia.org/wiki/Zebularine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| ImageFile = Zebularine.svg | ImageSize = 200px | IUPACName = 1-(β-D-Ribofuranosyl)pyrimidin-2(1H)-one | SystematicName = 1-[(2R,3R,4S,5R)-3,4-Dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2(1H)-one | OtherNames = Pyrimidin-2-one β-D-ribofuranoside |Section1={{Chembox Identifiers | IUPHAR_ligand = 4729 | CASNo = 3690-10-6 | UNII_Ref = | UNII = 7A9Y5SX0GY | PubChem = 100016 | ChemSpiderID = 90372 | SMILES = O=C1/N=C\C=C/N1[C@@H]2OC@@HCO | InChI = 1/C9H12N2O5/c12-4-5-6(13)7(14)8(16-5)11-3-1-2-10-9(11)15/h1-3,5-8,12-14H,4H2/t5-,6-,7-,8-/m1/s1 | InChIKey = RPQZTTQVRYEKCR-WCTZXXKLBP | StdInChI = 1S/C9H12N2O5/c12-4-5-6(13)7(14)8(16-5)11-3-1-2-10-9(11)15/h1-3,5-8,12-14H,4H2/t5-,6-,7-,8-/m1/s1 | StdInChIKey = RPQZTTQVRYEKCR-WCTZXXKLSA-N |Section2={{Chembox Properties | C=9 | H=12 | N=2 | O=5 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =
Zebularine is a nucleoside analog of cytidine. It is a transition state analog inhibitor of cytidine deaminase by binding to the active site as covalent hydrates. Also shown to inhibit DNA methylation and tumor growth both in vitro and in vivo.
In a small study of mice with a defective Adenomatous polyposis coli gene, oral administration of zebularine to males had no effect on the overall methylation of DNA or the number of polyps, but in females the average number of polyps was reduced from 58 to 1. It has therefore been suggested for drug use as a prototype of epigenetic therapy for cancer chemoprevention.
| align = left | image1 = zebularine2.svg | width1 = 100 | alt1 = | caption1 = | image2 = Cytidin.svg | width2 = 100 | alt2 = | caption2 = | footer = Zebularine (left) closely resembles cytidine (right), but lacks the 4'-amino group.
References
References
- "pyrimidin-2-one beta-ribofuranoside - Compound Summary". [[PubChem]]/[[National Center for Biotechnology Information]].
- (September 2008). "Long-term Epigenetic Therapy with Oral Zebularine Has Minimal Side Effects and Prevents Intestinal Tumors in Mice". [[Cancer Prev Res]].
- (15 April 2005). "Cancer epigenetics". [[Hum. Mol. Genet.]].
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::