WY-46824
Chemical compound
title: "WY-46824" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["cyclohexanols", "norepinephrine–dopamine-reuptake-inhibitors", "3-chlorophenyl-compounds", "phenethylamines", "4-methylpiperazin-1-yl-compounds", "tertiary-alcohols"] description: "Chemical compound" topic_path: "general/cyclohexanols" source: "https://en.wikipedia.org/wiki/WY-46824" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
| verifiedrevid = | IUPAC_name = 1-[1-(3-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]cyclohexan-1-ol | image = WY-46824.svg | image_class = skin-invert-image | width = 200
| tradename = | pregnancy_category = | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = | CAS_number = 122718-49-4 | UNII_Ref = | UNII = 99T4HMN9HV | ATC_prefix = | ATC_suffix = | ATC_supplemental = | ChEMBL = 511347 | PubChem = 10314993 | ChemSpiderID = 8490458
| C=19 | H=29 | Cl=1 | N=2 | O=1 | smiles = CN1CCN(CC1)CC(C2=CC(=CC=C2)Cl)C3(CCCCC3)O | StdInChI = 1S/C19H29ClN2O/c1-21-10-12-22(13-11-21)15-18(16-6-5-7-17(20)14-16)19(23)8-3-2-4-9-19/h5-7,14,18,23H,2-4,8-13,15H2,1H3 | StdInChIKey = GRUIIAQNNWQJPW-UHFFFAOYSA-N
WY-46824 is a norepinephrine-dopamine reuptake inhibitor related to venlafaxine. It was disclosed by Paige Mahaney and colleagues from Wyeth in 2008. The compound was mentioned in an earlier article from 2007 but was not the main focus of that study.
WY-46824 has binding affinities of 46 nM for the norepinephrine transporter (NET), 58 nM for the dopamine transporter (DAT), and 18795 nM for the serotonin transporter (SERT). The racemic mixture of WY-46824 was resolved into its constituent enantiomers, with the (S)-enantiomer being the more active one. The N-desmethyl derivative of WY-46824 also shows similar activity.
References
References
- (July 2008). "Structure-activity relationships of the cycloalkanol ethylamine scaffold: discovery of selective norepinephrine reuptake inhibitors". Journal of Medicinal Chemistry.
- (November 2007). "Desvenlafaxine succinate identifies novel antagonist binding determinants in the human norepinephrine transporter". The Journal of Pharmacology and Experimental Therapeutics.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::