Vitexin

Quality 0.50 · 2 views · Updated 2 months ago

title: "Vitexin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["flavone-glucosides", "c-glycoside-natural-phenols"] topic_path: "general/flavone-glucosides" source: "https://en.wikipedia.org/wiki/Vitexin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Watchedfields = changed | verifiedrevid = 470631187 | ImageFile =Vitexin.svg | ImageSize = | IUPACName = 8-(β-D-Glucopyranosyl)-4′,5,7-trihydroxyflavone | SystematicName = 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-1-benzopyran-4-one | OtherNames =Apigenin-8-C-glucoside |Section1={{Chembox Identifiers | ChemSpiderID_Ref = | ChemSpiderID = 4444098 | InChI = 1/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2/t14-,17-,18+,19-,21+/m1/s1 | InChIKey = SGEWCQFRYRRZDC-VPRICQMDBU | StdInChI_Ref = | StdInChI = 1S/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2/t14-,17-,18+,19-,21+/m1/s1 | StdInChIKey_Ref = | StdInChIKey = SGEWCQFRYRRZDC-VPRICQMDSA-N | CASNo_Ref = | CASNo =3681-93-4 | UNII_Ref = | UNII = 9VP70K75OK | KEGG_Ref = | KEGG = C01460 | PubChem =5280441 | ChEMBL_Ref = | ChEMBL = 487417 | ChEBI_Ref = | ChEBI = 16954 | SMILES = O=C2\C=C(/Oc1c(c(O)cc(O)c12)[C@@H]3OC@@HCO)c4ccc(O)cc4 |Section2={{Chembox Properties | Formula =C21H20O10 | MolarMass = 432.38 g/mol | Appearance = Light yellow powder | Density = | MeltingPtC = 203 to 204 | MeltingPt_notes = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =

Vitexin is an apigenin flavone glucoside, a chemical compound found in the passion flower, Vitex agnus-castus (chaste tree or chasteberry), in the Phyllostachys nigra bamboo leaves, in the pearl millet (Pennisetum millet), and in Hawthorn.

Metabolism

Goitrogenicity of millet flavones : Vitexin inhibits thyroid peroxidase thus contributing to goiter.

References

References

  1. (2007). "Isolation and purification of four flavone C-glycosides from antioxidant of bamboo leaves by macroporous resin column chromatography and preparative high-performance liquid chromatography". Food Chemistry.
  2. J.O. AKINGBALA. (1991). "Effect of Processing on Flavonoids in Millet (Pennisetum americanum) Flour". Cereal Chem..
  3. Scholz, Hildemar. (1995). "Gustav Hegi. Illustrierte Flora von Mitteleuropa IV(2B). Spermatophyta: Angiospermae: Dicotyledones 2(3). Rosaceae 2". Blackwell Wissenschafts-Verlag.
  4. (1990). "Goitrogens in food and water.". Annual Review of Nutrition.
  5. (1987). "Goitre causing compounds found in pearl millet". Nutr. Rep. Int..

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

flavone-glucosidesc-glycoside-natural-phenols