Viminol

Opioid analgesic medicine
title: "Viminol" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["opioids", "pyrroles", "secondary-alcohols", "2-chlorophenyl-compounds", "mu-opioid-receptor-agonists"] description: "Opioid analgesic medicine" topic_path: "general/opioids" source: "https://en.wikipedia.org/wiki/Viminol" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Opioid analgesic medicine ::
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 448072389 | IUPAC_name = 1-[1-[(2-Chlorophenyl)methyl]pyrrol-2-yl]-2-[di(butan-2-yl)amino]ethanol | image = Viminol2DACS.svg | image_class = skin-invert-image | width = 180
| tradename = Dividol | Drugs.com = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_BR = A1 | legal_BR_comment = | legal_status = | routes_of_administration = Oral
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = | CAS_number = 21363-18-8 | ATC_prefix = N02 | ATC_suffix = BG05 | PubChem = 65697 | ChEMBL_Ref = | ChEMBL = 2104940 | DrugBank_Ref = | DrugBank = | UNII_Ref = | UNII = TPV54G6XBG | KEGG_Ref = | KEGG = D07295 | ChemSpiderID_Ref = | ChemSpiderID = 59125
| C=21 | H=31 | Cl=1 | N=2 | O=1 | smiles = CCC(C)N(C(C)CC)CC(O)C1=CC=CN1CC2=CC=CC=C2Cl | synonyms = Dividol, viminolo, diviminol | StdInChI_Ref = | StdInChI = 1S/C21H31ClN2O/c1-5-16(3)24(17(4)6-2)15-21(25)20-12-9-13-23(20)14-18-10-7-8-11-19(18)22/h7-13,16-17,21,25H,5-6,14-15H2,1-4H3 | StdInChIKey_Ref = | StdInChIKey = ZILPIBYANAFGMS-UHFFFAOYSA-N |drug_name=|alt=|caption=|type=|MedlinePlus=|licence_EU=|licence_US=}}
Viminol (marketed under the brandname Dividol) is an opioid analgesic developed by a team at the drug company Zambon in the 1960s. Viminol is based on the α-pyrryl-2-aminoethanol structure, unlike any other class of opioids.
Viminol has both antitussive (cough suppressing) and analgesic (pain reducing) effects. Viminol has additional effects similar to other opioids including sedation and euphoria. It has six different stereoisomers which have varying properties. Four are inactive, but the 1S-(R,R)-disecbutyl isomer is a μ-opioid full agonist around 5.5 times more potent than morphine and the 1S-(S,S)-disecbutyl isomer is an antagonist. Since viminol is supplied as a racemic mixture of isomers, the overall effect is a mixed agonist–antagonist profile similar to that of opioids such as pentazocine, although with somewhat fewer side effects.
Side effects
Side effects are similar to other opioids, and can include:
- Itching
- Nausea
- Sedation
- Respiratory depression - can be potentially life-threatening
However, since viminol is supplied as a racemic mixture of agonist and antagonist isomers, the abuse potential and respiratory depression tends to be less than that of μ-opioid full agonist drugs.
Drug dependence may occur.
Related compounds
Later work showed that replacing the chlorine atom with a fluorine atom (2F-Viminol) or with a trifluoromethyl group produced a compound with twice the potency and half the acute toxicity. A later team at Zambon found that one isomer of a pyrrolidone analog is 318 times as potent as morphine in its analgesic activity in animal studies. A number of related compounds were also found to be active, allowing a QSAR model to be constructed.
| align = left | direction = horizontal | image1 = Viminol trifluoromethyl derivative.svg | caption1 = Trifluoromethyl analog | image2 = 2F-Viminol_structure.png | caption2 = Fluoro analog "2F-Viminol" | image3 = Viminol pyrrolidone derivative.svg | caption3 = Pyrrolidone analog, Z4349
References
References
- Anvisa. (2024-05-28). "RDC Nº 877 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial". [[Diário Oficial da União]].
- "1-(α-Pyrryl)-2-amino Ethanols".
- (April 1981). "[Chromatographic separation of diastereoisomers of aminoalcohol salts and their densitometric determination]". Il Farmaco; Edizione Pratica.
- (December 1977). "Psychopharmacological properties of the viminol-p-hydroxybenzoate". Revista Brasileira de Pesquisas Médicas e Biológicas.
- "Stereoisomers of 1(1'(-O-Chlorobenzyl)-2'-Pyrryl)-2-Disec.Butylamino-Ethanol".
- (January 1984). "The discriminative stimulus properties of the R2 isomer of viminol". Pharmacology, Biochemistry, and Behavior.
- (May 1986). "Viminol R2 analgesic activity in patients with postoperative pain: comparison with pentazocine". International Journal of Clinical Pharmacology, Therapy, and Toxicology.
- (2009). "Dependence on Viminol". Journal of Substance Use.
- "Stereoisomers of 1-(1'benzyl-2'pyrryl)-2-di-sec.-butylaminoethanol and pharmaceutical compositions comprising same".
- "Pyrrolidone-2 compounds and their use for central analgesic activity".
- (1995). "Stereoselective synthesis and evaluation of all stereoisomers of Z4349, a novel and selective μ-opioid analgesic.". Bioorganic & Medicinal Chemistry Letters.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::