Valrubicin

Pharmaceutical drug


title: "Valrubicin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["anthracyclines", "topoisomerase-inhibitors", "trifluoromethyl-compounds", "acetamides", "withdrawn-drugs"] description: "Pharmaceutical drug" topic_path: "general/anthracyclines" source: "https://en.wikipedia.org/wiki/Valrubicin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Pharmaceutical drug ::

| verifiedrevid = 470628311 | IUPAC_name = 2-oxo-2-[(2S,4S)-2,5,12-trihydroxy-7-methoxy-6,11-dioxo-4-({2,3,6-trideoxy-3-[(trifluoroacetyl)amino]hexopyranosyl}oxy)-1,2,3,4,6,11-hexahydrotetracen-2-yl]ethyl pentanoate | image = Valrubicin.svg | image_class = skin-invert-image

| tradename = | Drugs.com = | MedlinePlus = a611021 | pregnancy_US = C | legal_status = Rx-only | routes_of_administration = Intravesical

| bioavailability = Negligible | protein_bound = 99% | metabolism = Negligible | excretion = In urine

| CAS_number_Ref = | CAS_number = 56124-62-0 | ATC_prefix = L01 | ATC_suffix = DB09 | PubChem = 454216 | DrugBank_Ref = | DrugBank = DB00385 | ChemSpiderID_Ref = | ChemSpiderID = 399974 | UNII_Ref = | UNII = 2C6NUM6878 | ChEMBL_Ref = | ChEMBL = 1096885

| C=34 | H=36 | F=3 | N=1 | O=13 | smiles = FC(F)(F)C(=O)N[C@@H]5C@HC@@HC | StdInChI_Ref = | StdInChI = 1S/C34H36F3NO13/c1-4-5-9-21(40)49-13-20(39)33(47)11-16-24(19(12-33)51-22-10-17(27(41)14(2)50-22)38-32(46)34(35,36)37)31(45)26-25(29(16)43)28(42)15-7-6-8-18(48-3)23(15)30(26)44/h6-8,14,17,19,22,27,41,43,45,47H,4-5,9-13H2,1-3H3,(H,38,46)/t14-,17-,19-,22-,27+,33-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = ZOCKGBMQLCSHFP-KQRAQHLDSA-N Valrubicin (N-trifluoroacetyladriamycin-14-valerate, trade name Valstar) is a chemotherapy drug used to treat bladder cancer. Valrubicin is a semisynthetic analog of the anthracycline doxorubicin, and is administered by infusion directly into the bladder.

It was originally launched as Valstar in the U.S. in 1999 for intravesical therapy of Bacille Calmette-Guérin (BCG)-refractory carcinoma in situ of the urinary bladder in patients in whom cystectomy would be associated with unacceptable morbidity or mortality; however, it was voluntarily withdrawn in 2002 due to manufacturing issues. Valstar was relaunched on September 3, 2009.

Side effects

References

References

  1. (2015). "Valrubicin in refractory non-muscle invasive bladder cancer". Expert Review of Anticancer Therapy.
  2. U.S. Food and Drug Administration]] News. The MQN Weekly Bulletin, Jan. 11, 2008
  3. (2009-09-03). "Endo Pharmaceuticals launches VALSTAR for treating recurrent carcinoma in situ bladder tumors".

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

anthracyclinestopoisomerase-inhibitorstrifluoromethyl-compoundsacetamideswithdrawn-drugs