Urobilin

Yellow pigment in urine
title: "Urobilin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["biological-pigments", "tetrapyrroles", "shades-of-yellow", "lactams", "urine"] description: "Yellow pigment in urine" topic_path: "philosophy" source: "https://en.wikipedia.org/wiki/Urobilin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Yellow pigment in urine ::
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 470620560 | ImageFile = I-Urobilin-neutral.svg | ImageSize = 250px | IUPACName = 3,3′-[(4S,16S)-3,18-Diethyl-2,7,13,17-tetramethyl-1,19-dioxo-1,4,5,15,16,19,22,24-octahydro-21H-biline-8,12-diyl]dipropanoic acid | SystematicName = 3,3′-([12S,4(52)Z,72S]-13,74-Diethyl-14,33,54,73-tetramethyl-15,75-dioxo-12,15,72,75-tetrahydro-11H,31H,71H-1,7(2),3,5(2,5)-tetrapyrrolaheptaphan-4(52)-ene-34,53-diyl)dipropanoic acid | OtherNames = Urochrome |Section1={{Chembox Identifiers | ChemSpiderID_Ref = | ChemSpiderID = 4938471 | StdInChI_Ref = | StdInChI = 1S/C33H42N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h15,26-27,35H,7-14H2,1-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b28-15-/t26-,27-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = KDCCOOGTVSRCHX-UYMYUHGCSA-N | CASNo = 1856-98-0 | CASNo_Ref = | UNII_Ref = | UNII = G0OTH73Y0M | PubChem = 6433298 | SMILES = CCC1=C(C(=O)N[C@H]1CC2=C(C(=C(N2)/C=C\3/C(=C(C(=N3)C[C@H]4C(=C(C(=O)N4)CC)C)C)CCC(=O)O)CCC(=O)O)C)C | MeSHName = Urobilin |Section2={{Chembox Properties | C=33 | H=42 | N=4 | O=6 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt =
Urobilin, also known as urochrome, is the chemical primarily responsible for the yellow color of urine. It is a linear tetrapyrrole compound that, along with the related colorless compound urobilinogen, are degradation products of the cyclic tetrapyrrole heme.
Metabolism
Urobilin is generated from the degradation of heme, which is first degraded through biliverdin to bilirubin. Bilirubin is then excreted as bile, which is further degraded by microbes present in the large intestine to urobilinogen. The enzyme responsible for the degradation is bilirubin reductase, which was identified in 2024. Some of this remains in the large intestine, and its conversion to stercobilin gives feces their brown color. Some is reabsorbed into the bloodstream and then delivered to the kidneys. When urobilinogen is exposed to air, it is oxidized to urobilin, which has a yellow color.{{cite book | title = Guyton and Hall Textbook of Medical Physiology, 13th edition | chapter = The liver as an organ | author1 = John E. Hall | publisher = Elsevier | year = 2016 | isbn = 978-1455770052 | page = 885 | author1-link = John E. Hall (science writer)
Importance
Many urine tests (urinalysis) monitor the amount of urobilin in urine, as its levels can give insight on the effectiveness of urinary tract function. Normally, urine would appear as either light yellow or colorless. A lack of water intake, for example following sleep or dehydration, reduces the water content of urine, thereby concentrating urobilin and producing a darker color of urine. Obstructive jaundice reduces biliary bilirubin excretion, which is then excreted directly from the blood stream into the urine, giving a dark-colored urine but with a paradoxically low urobilin concentration, no urobilinogen, and usually with correspondingly pale faeces. Darker urine can also be due to other chemicals, such as various ingested dietary components or drugs, porphyrins in patients with porphyria, and homogentisate in patients with alkaptonuria.
References
References
- (January 2024). "BilR is a gut microbial enzyme that reduces bilirubin to urobilinogen". Nature Microbiology.
- Rayne, Elizabeth. (2024-01-27). "Gotta go? We've finally found out what makes urine yellow".
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::