Trypanothione


title: "Trypanothione" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["thiols", "peptides"] topic_path: "general/thiols" source: "https://en.wikipedia.org/wiki/Trypanothione" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | verifiedrevid = 470618372 | Name=Trypanothione | ImageFile=Trypanothione(red).svg | ImageClass = skin-invert-image | ImageSize=280px | ImageFile1=Trypanothione(ox).svg | ImageClass1 = skin-invert-image | ImageSize1=270px | ImageName1=Trypanthione (oxidized) | ImageCaption1 = Reduced form (top) and oxidized form (bottom) | IUPACName= | OtherNames=N1,N8-Bis(glutathionyl)spermidine |Section1={{Chembox Identifiers | InChI = 1/C27H47N9O10S2/c28-16(26(43)44)4-6-20(37)35-18-14-47-48-15-19(36-21(38)7-5-17(29)27(45)46)25(42)34-13-23(40)32-11-3-9-30-8-1-2-10-31-22(39)12-33-24(18)41/h16-19,30H,1-15,28-29H2,(H,31,39)(H,32,40)(H,33,41)(H,34,42)(H,35,37)(H,36,38)(H,43,44)(H,45,46)/t16-,17-,18-,19-/m0/s1 | InChIKey = LZMSXDHGHZKXJD-VJANTYMQBI | StdInChI_Ref = | StdInChI = 1S/C27H47N9O10S2/c28-16(26(43)44)4-6-20(37)35-18-14-47-48-15-19(36-21(38)7-5-17(29)27(45)46)25(42)34-13-23(40)32-11-3-9-30-8-1-2-10-31-22(39)12-33-24(18)41/h16-19,30H,1-15,28-29H2,(H,31,39)(H,32,40)(H,33,41)(H,34,42)(H,35,37)(H,36,38)(H,43,44)(H,45,46)/t16-,17-,18-,19-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = LZMSXDHGHZKXJD-VJANTYMQSA-N | CASNo_Ref = | CASNo=96304-42-6 | CASNo_Comment = (oxidized) | PubChem=115098 | PubChem_Comment = (oxidized) | ChemSpiderID_Ref = | ChemSpiderID = 102998 | ChemSpiderID_Comment = (oxidized) | ChemSpiderID1_Ref = | ChemSpiderID1 = 396023 | ChemSpiderID1_Comment = (reduced) | ChEBI_Ref = | ChEBI = 35490 | SMILES = O=C(O)C@@HCCC(=O)N[C@@H]1C(=O)NCC(=O)NCCCNCCCCNC(=O)CNC(=O)C@@HCSSC1 |Section2={{Chembox Properties | Formula=C27H47N9O10S2 (oxidized) C27H49N9O10S2 (reduced) | MolarMass=721.84 g/mol (oxidized) 723.86 g/mol (reduced) | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = Trypanothione is an unusual form of glutathione containing two molecules of glutathione joined by a spermidine (polyamine) linker. It is found in parasitic protozoa such as leishmania and trypanosomes. These protozoal parasites are the cause of leishmaniasis, sleeping sickness and Chagas' disease. Trypanothione was discovered by Alan Fairlamb. Its structure was proven by chemical synthesis.{{Cite journal | pmid = 3883489 | date=Mar 1985 | last1 = Fairlamb | first1 = A. H. | last2 = Blackburn | first2 = P. | last3 = Ulrich | first3 = P. | last4 = Chait | first4 = B. T. | last5 = Cerami | first5 = A. | title = Trypanothione: a novel bis(glutathionyl)spermidine cofactor for glutathione reductase in trypanosomatids | volume = 227 | issue = 4693 | pages = 1485–1487 | issn = 0036-8075 | journal = Science | doi = 10.1126/science.3883489 |bibcode = 1985Sci...227.1485F }} It is present mainly in the Kinetoplastida but can be found in other parasitic protozoa such as Entamoeba histolytica. Since this thiol is absent from humans and is essential for the survival of the parasites, the enzymes that make and use this molecule are targets for the development of new drugs to treat these diseases.

Trypanothione-dependent enzymes include reductases, peroxidases, glyoxalases and transferases. Trypanothione-disulfide reductase (TryR) was the first trypanothione-dependent enzyme to be discovered (EC 1.8.1.12). It is an NADPH-dependent flavoenzyme that reduces trypanothione disulfide. TryR is essential for survival of these parasites both in vitro and in the human host.

A major function of trypanothione is in the defence against oxidative stress. Here, trypanothione-dependent enzymes such as tryparedoxin peroxidase (TryP) reduce peroxides using electrons donated either directly from trypanothione, or via the redox intermediate tryparedoxin (TryX). Trypanothione-dependent hydrogen peroxide metabolism is particularly important in these organisms because they lack catalase. Since the trypanosomatids also lack an equivalent of thioredoxin reductase, trypanothione reductase is the sole path that electrons can take from NADPH to these antioxidant enzymes.

::figure[src="https://upload.wikimedia.org/wikipedia/commons/6/69/TryP_cycle.png"] ::

References

References

  1. (1992). "Metabolism and functions of trypanothione in the Kinetoplastida". Annu. Rev. Microbiol..
  2. (2005). "Identification of trypanothione from the human pathogen Entamoeba histolytica by mass spectrometry and chemical analysis". Biotechnol. Appl. Biochem..
  3. (November 2002). "Enzymes of the trypanothione metabolism as targets for antitrypanosomal drug development". Curr Top Med Chem.
  4. (July 1998). "Evidence that trypanothione reductase is an essential enzyme in Leishmania by targeted replacement of the tryA gene locus". Mol. Microbiol..
  5. (February 2000). "Trypanosomes lacking trypanothione reductase are avirulent and show increased sensitivity to oxidative stress". Mol. Microbiol..
  6. (April 2003). "The parasite-specific trypanothione metabolism of trypanosoma and leishmania". Biol. Chem..

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

thiolspeptides