Triprolidine

Quality 0.50 · 0 views · Updated 2 months ago

Antihistamine medication

title: "Triprolidine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["alkene-derivatives", "h1-receptor-antagonists", "muscarinic-antagonists", "2-pyridyl-compounds", "1-pyrrolidinyl-compounds", "4-tolyl-compounds", "over-the-counter-drugs-in-the-united-states"] description: "Antihistamine medication" topic_path: "geography/united-states" source: "https://en.wikipedia.org/wiki/Triprolidine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Antihistamine medication ::

::callout[type=note] the drug ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 470617213 | IUPAC_name = 2-[(E)-1-(4-methylphenyl)-3-pyrrolidin-1-yl- prop-1-enyl]pyridine | image = Triprolidine Structural Formula V1.svg | image_class = skin-invert-image | tradename = Flonase Nighttime Allergy Relief, Actidil, others | Drugs.com = | pregnancy_category = C (US) | legal_US = otc | routes_of_administration = By mouth | bioavailability = Oral: 4% | protein_bound = 90% | metabolism = Hepatic (CYP2D6) | elimination_half-life = 4–6 hours | excretion = Renal | CAS_number_Ref = | CAS_number = 486-12-4 | ATC_prefix = R06 | ATC_suffix = AX07 | PubChem = 5282443 | IUPHAR_ligand = 1228 | DrugBank_Ref = | DrugBank = DB00427 | ChemSpiderID_Ref = | ChemSpiderID = 4445597 | UNII_Ref = | UNII = 2L8T9S52QM | KEGG_Ref = | KEGG = D01782 | ChEBI_Ref = | ChEBI = 84116 | ChEMBL_Ref = | ChEMBL = 855 | C = 19 | H = 22 | N = 2 | SMILES = n3c(\C(=C\CN1CCCC1)c2ccc(cc2)C)cccc3 | StdInChI_Ref = | StdInChI = 1S/C19H22N2/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21/h2-3,6-12H,4-5,13-15H2,1H3/b18-11+ | StdInChIKey_Ref = | StdInChIKey = CBEQULMOCCWAQT-WOJGMQOQSA-N | melting_point = 60 | solubility = 500 Triprolidine is an over-the-counter antihistamine with anticholinergic properties. It is used to combat the symptoms associated with allergies and is sometimes combined with other cold medications designed to provide general relief for flu-like symptoms. As with many antihistamines, the most common side effect is drowsiness.

Triprolidine was patented in 1948 and came into medical use in 1953, and has mostly been replaced in popular medications by other antihistamines including diphenhydramine, promethazine, chlorpheniramine, as well as by second-generation antihistamines including loratadine and fexofenadine. Triprolidine remains an ingredient in the cold medicine Actifed in many territories.

References

References

  1. (January 1993). "The new H1 antihistamines. Treatment of urticaria and other clinical problems". Dermatologic Clinics.
  2. (1984). "Bioavailability of pseudoephedrine and triprolidine from combination and single-ingredient products". Clinical Pharmacy.
  3. (2006). "Analogue-based Drug Discovery". John Wiley & Sons.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

alkene-derivativesh1-receptor-antagonistsmuscarinic-antagonists2-pyridyl-compounds1-pyrrolidinyl-compounds4-tolyl-compoundsover-the-counter-drugs-in-the-united-states