Tributyrin

Triglyceride found in butter


title: "Tributyrin" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["prodrugs", "triglycerides"] description: "Triglyceride found in butter" topic_path: "general/prodrugs" source: "https://en.wikipedia.org/wiki/Tributyrin" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Triglyceride found in butter ::

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 436131726 | ImageFile = Tributyrin.png | ImageSize = 240px | ImageAlt = Skeletal formula of butyrin | ImageFile1 = Tributyrin 3D ball.png | ImageSize1 = 240 | ImageAlt1 = Ball-and-stick model of the butyrin molecule | SystematicName = Propane-1,2,3-triyl tributanoate | OtherNames = Tributyrin |Section1={{Chembox Identifiers | ChemSpiderID_Ref = | ChemSpiderID = 13849665 | UNII_Ref = | UNII = S05LZ624MF | ChEBI_Ref = | ChEBI = 35020 | CASNo = 60-01-5 | KEGG = C13870 | PubChem = 6050 | StdInChI = 1S/C15H26O6/c1-4-7-13(16)19-10-12(21-15(18)9-6-3)11-20-14(17)8-5-2/h12H,4-11H2,1-3H3 | StdInChIKey = UYXTWWCETRIEDR-UHFFFAOYSA-N | SMILES = CCCC(=O)OCC(COC(=O)CCC)OC(=O)CCC |Section2={{Chembox Properties | C=15|H=26|O=6 | Appearance=Oily liquid with bitter taste | Density= | MeltingPtC=-75 | MeltingPt_ref = | BoilingPtC=305 to 310 | BoilingPt_ref = | Solubility=Insoluble |Section3={{Chembox Hazards | ExternalSDS = Tributyrin MSDS, Fischer Scientific | MainHazards= | FlashPt= | AutoignitionPt =

Tributyrin is a triglyceride naturally present in butter. It is an ester composed of butyric acid and glycerol. Among other things, it is used as an ingredient in making margarine. It is present in butter and can be described as a liquid fat with an acrid taste.

Tributyrin is also used in microbiological laboratories to identify the bacterium Moraxella catarrhalis.{{Cite journal | last = Pérez | first = José L. | first2 = Angeles | last2 = Pulido | first3 = Florencia | last3 = Pantozzi | first4 = Rogelio | last4 = Martin | date = October 1990 | title = Butyrate esterase (4-methylumbelliferyl butyrate) spot test, a simple method for immediate identification of Moraxella (Branhamella) catarrhalis corrected | journal = Journal of Clinical Microbiology | volume = 28 | issue = 10 | pages = 2347–2348 | publisher = American Society for Microbiology | location = Washington, DC | doi = 10.1128/jcm.28.10.2347-2348.1990 | issn = 1098-660X | pmid = 2121784 | pmc = 268174 | format = PDF Reprint

Tributyrin is a stable and rapidly absorbed prodrug of butyric acid which enhances antiproliferative effects of dihydroxycholecalciferol in human colon cancer cells.{{cite journal | last = Gaschott | first = Tanja | first2 = Dieter | last2 = Steinhilber | first3 = Vladan | last3 = Milovic | first4 = Jürgen | last4 = Stein | date = June 2001 | title = Tributyrin, a Stable and Rapidly Absorbed Prodrug of Butyric Acid, Enhances Antiproliferative Effects of Dihydroxycholecalciferol in Human Colon Cancer Cells | journal = The Journal of Nutrition | volume = 131 | issue = 6 | pages = 1839–1843 | publisher = The American Society for Nutritional Sciences | location = Bethesda, MD | issn = 1541-6100 | pmid = 11385076 | doi = 10.1093/jn/131.6.1839 | url = http://jn.nutrition.org/cgi/content/full/131/6/1839 | accessdate = 2009-08-17 | doi-access= free

References

References

  1. {{Merck12th

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

prodrugstriglycerides