Trefentanil

Quality 0.50 · 1 view · Updated 2 months ago

Chemical compound

title: "Trefentanil" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["opioids", "piperidines", "tetrazoles", "2-fluorophenyl-compounds", "propionamides", "anilides", "mu-opioid-receptor-agonists"] description: "Chemical compound" topic_path: "general/opioids" source: "https://en.wikipedia.org/wiki/Trefentanil" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

::summary Chemical compound ::

| Verifiedfields = changed | verifiedrevid = 470612615 | IUPAC_name = N-{1-[2-(4-ethyl-5-oxo-4,5-dihydro-1H-tetrazol-1-yl)ethyl]-4-phenylpiperidin-4-yl}-N-(2-fluorophenyl)propanamide | image = Trefentanil Structure.svg | image_class = skin-invert-image | width = 220px | image2 = Trefentanil 3D BS.png | image_class2 = bg-transparent | width2 = 220px | CAS_number_Ref = | CAS_number = 120656-74-8 | CAS_number2_Ref = | CAS_number2 = 120656-93-1 | UNII_Ref = | UNII = 36QM58LVGU

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| index2_label = HCl | ATC_prefix = none | ATC_suffix = | PubChem = 60728 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 54732 | UNII2_Ref = | UNII2 = 20742ZOB3G | ChEMBL_Ref = | ChEMBL = 84617

| C=25 | H=31 | F=1 | N=6 | O=2 | smiles = Fc1ccccc1N(C(=O)CC)C4(c2ccccc2)CCN(CCN3\N=N/N(C3=O)CC)CC4 | StdInChI_Ref = | StdInChI = 1S/C25H31FN6O2/c1-3-23(33)32(22-13-9-8-12-21(22)26)25(20-10-6-5-7-11-20)14-16-29(17-15-25)18-19-31-24(34)30(4-2)27-28-31/h5-13H,3-4,14-19H2,1-2H3 | StdInChIKey_Ref = | StdInChIKey = RJSCINHYBGMIFT-UHFFFAOYSA-N | synonyms =

Trefentanil (A-3665) is an opioid analgesic that is an analogue of fentanyl and was developed in 1992.

Trefentanil is most similar to short-acting fentanyl analogues such as alfentanil. In comparative studies, trefentanil was slightly more potent and shorter acting than alfentanil as an analgesic, but induced significantly more severe respiratory depression. For this reason trefentanil has not been adopted for clinical use, although it is still used in research.

Trefentanil has very similar effects to alfentanil, much like those of fentanyl itself but more potent and shorter lasting. Side effects of fentanyl analogs are similar to those of fentanyl itself, which include itching, nausea and potentially serious respiratory depression, which can be life-threatening. Fentanyl analogs have killed hundreds of people throughout Europe and the former Soviet republics since the most recent resurgence in use began in Estonia in the early 2000s, and novel derivatives continue to appear. The risk of respiratory depression is especially high with potent fentanyl analogues such as alfentanil and trefentanil, and these drugs pose a significant risk of death if used outside of a hospital setting with appropriate artificial breathing apparatus available.

References

References

  1. (April 1993). "A-3665, a new short-acting opioid: a comparison with alfentanil". Anesthesia and Analgesia.
  2. (September 1994). "Pharmacokinetic-pharmacodynamic modeling in drug development: application to the investigational opioid trefentanil". Clinical Pharmacology and Therapeutics.
  3. (July 2015). "Fentanyls: Are we missing the signs? Highly potent and on the rise in Europe". The International Journal on Drug Policy.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

opioidspiperidinestetrazoles2-fluorophenyl-compoundspropionamidesanilidesmu-opioid-receptor-agonists