Tolidine


title: "Tolidine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["biphenyls", "symmetrical-biaryls"] topic_path: "general/biphenyls" source: "https://en.wikipedia.org/wiki/Tolidine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 446718238 | Name = 2-Tolidine | Reference = | ImageFile = 2-tolidine.svg | ImageAlt = | PIN = 3,3′-Dimethyl-[1,1′-biphenyl]-4,4′-diamine | OtherNames = o-Tolidine; Orthotolidine; Diaminoditolyl; Diaminotolyl; Bianisidine; Tolidine blue; 3,3'-Dimethylbenzidine; 4,4'-Bi-o-toluidine |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 119-93-7 | ChEMBL = 85109 | UNII_Ref = | UNII = 63HLO2IV6K | PubChem = 8413 | KEGG_Ref = | KEGG = C14443 | SMILES = CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N | InChI = 1/C14H16N2/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12/h3-8H,15-16H2,1-2H3 | InChIKey = NUIURNJTPRWVAP-UHFFFAOYAK | StdInChI_Ref = | StdInChI = 1S/C14H16N2/c1-9-7-11(3-5-13(9)15)12-4-6-14(16)10(2)8-12/h3-8H,15-16H2,1-2H3 | StdInChIKey_Ref = | StdInChIKey = NUIURNJTPRWVAP-UHFFFAOYSA-N | ChEBI_Ref = | ChEBI = 34320 | ChemSpiderID_Ref = | ChemSpiderID = 8106 | EINECS = 204-358-0 |Section2={{Chembox Properties | C=14 | H=16 | N=2 | Appearance = White to reddish crystals or powder | Density = 1.23 g/cm3 | MeltingPtC = 129 | BoilingPtC = 300.5 | Solubility = 1.3 g/L}} |Section3={{Chembox Hazards | MainHazards = potential carcinogen | FlashPtC = 244 | AutoignitionPtC = | GHSPictograms = | GHSSignalWord = Danger | HPhrases = | PPhrases = | IDLH = Ca [N.D.] | PEL = Handle with care | REL = Ca C 0.02 mg/m3 [60-minute] [skin]

2-Tolidine (orthotolidine, o-tolidine; not to be confused with o-toluidine) is an organic compound with the chemical formula . Several isomers are known; the 3-tolidine derivative is also important commercially. It is a colorless compound although commercial samples are often colored. It is slightly soluble in water. It forms salts with acids, such as the hydrochloride, which is commercially available.

2-Tolidine can be produced by benzidine rearrangement from a hydrazone derivative of 2-nitrotoluene. :

Uses

2-Tolidine is an aromatic amine used mainly for dye production. 2-Tolidine is an intermediate for the production of soluble azo dyes and insoluble pigments used particularly in the textile, leather and paper industries. ::figure[src="https://upload.wikimedia.org/wikipedia/commons/d/d5/PigYel16dichlorophenylediaso.svg" caption="[[Pigment Yellow 16]], a derivative of o-tolidine"] ::

It is also used for the production of certain elastomers. thumb|left|200px|Orthotolidine in chlorine test kit 2-Tolidine was widely used as a reagent or indicator in analytical, clinical and forensic chemistry, such as in the analytical determination of gold, or determination of the chlorine level in swimming pool water.

Safety

2-Tolidine is toxic and possibly carcinogenic. It is listed as an IARC Group 2B carcinogen, meaning it is "possibly carcinogenic to humans". Animal studies have shown that animals exposed to tolidine developed tumors in the liver, kidney, and mammary glands.

References

References

  1. {{GESTIS
  2. Noller, Carl R.: ''Textbook of Organic Chemistry'', Springer Verlag, 1960{{verify source. (March 2025{{page needed). (March 2025)
  3. K. Hunger. W. Herbst "Pigments, Organic" in ''Ullmann's Encyclopedia of Industrial Chemistry'', Wiley-VCH, Weinheim, 2012. {{doi. 10.1002/14356007.a20_371
  4. "CDC - NIOSH Pocket Guide to Chemical Hazards - o-Tolidine".

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

biphenylssymmetrical-biaryls