Tocofersolan
title: "Tocofersolan" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["vitamin-e", "multiple-chemboxes", "glycol-esters", "benzopyrans"] topic_path: "general/vitamin-e" source: "https://en.wikipedia.org/wiki/Tocofersolan" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::data[format=table title="Infobox drug"]
| Field | Value |
|---|---|
| USAN | Tocophersolan |
| tradename | Vedrop |
| Drugs.com | |
| DailyMedID | |
| pregnancy_AU | |
| ATC_prefix | |
| legal_AU | |
| legal_BR | |
| legal_CA | |
| legal_DE | |
| legal_NZ | |
| legal_UK | POM |
| legal_UK_comment | |
| legal_US | |
| legal_EU | Rx-only |
| legal_EU_comment | |
| legal_UN | |
| legal_status | |
| DrugBank | DB11635 |
| KEGG | D06174 |
| C | |
| K | |
| :: |
| Verifiedfields = changed | verifiedrevid = 470611287 | Name = | ImageFile = Tocophersolan.png | ImageClass = skin-invert-image | ImageSize = 250px | IUPACName = α-Hydro-ω-{[4-oxo-4-({(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-yl}oxy)butanoyl]oxy}poly(oxyethylene) | OtherNames = Tocofersolan; Vitamin E PEG succinate; α-Tocopherol polyethylene glycol succinate (TPGS); Liqui-E | SystematicName = | Section1 = {{Chembox Identifiers | CASNo_Ref = | CASNo=9002-96-4 | ChEMBL = 2355578 | ChemSpiderID_Ref = | ChemSpiderID = 64498 | DrugBank = DB11635 | EINECS = 618-345-6 | PubChem=9938056 | UNII_Ref = | UNII = O03S90U1F2 | InChI1 = 1/C35H58O6/c1-24(2)12-9-13-25(3)14-10-15-26(4)16-11-20-35(8)21-19-30-29(7)33(27(5)28(6)34(30)41-35)40-32(38)18-17-31(37)39-23-22-36/h24-26,36H,9-23H2,1-8H3 | InChIKey1 = AOBORMOPSGHCAX-UHFFFAOYAU | StdInChI_Ref = | StdInChI = 1S/C35H58O6/c1-24(2)12-9-13-25(3)14-10-15-26(4)16-11-20-35(8)21-19-30-29(7)33(27(5)28(6)34(30)41-35)40-32(38)18-17-31(37)39-23-22-36/h24-26,36H,9-23H2,1-8H3 | StdInChIKey_Ref = | StdInChIKey = AOBORMOPSGHCAX-UHFFFAOYSA-N | SMILES = O=C(OCCO)CCC(=O)Oc2c(c(c1OC(CCc1c2C)(C)CCCC(C)CCCC(C)CCCC(C)C)C)C | Section2 = {{Chembox Properties | Formula=(C2H4O)nC33H54O5 | MolarMass=Variable | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= | Section3 = | Section4 = | Section5 = | Section6 = {{Chembox Pharmacology | ATCCode_prefix = A11 | ATCCode_suffix = HA08 | Licence_EU=yes | Section7 = {{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = | image = | width = | alt = | caption = | USAN = Tocophersolan
| pronounce = | tradename = Vedrop | Drugs.com = | MedlinePlus = | DailyMedID = | pregnancy_AU = | pregnancy_AU_comment = | pregnancy_category= | routes_of_administration = | class = | ATC_prefix = | ATC_suffix = | ATC_supplemental =
| legal_AU = | legal_AU_comment = | legal_BR = | legal_BR_comment = | legal_CA = | legal_CA_comment = | legal_DE = | legal_DE_comment = | legal_NZ = | legal_NZ_comment = | legal_UK = POM | legal_UK_comment = | legal_US = | legal_US_comment = | legal_EU = Rx-only | legal_EU_comment = | legal_UN = | legal_UN_comment = | legal_status =
| bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =
| CAS_number_Ref = | CAS_number = | CAS_supplemental = | PubChem = | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = DB11635 | ChemSpiderID_Ref = | ChemSpiderID = | UNII_Ref = | UNII = | KEGG_Ref = | KEGG = D06174 | ChEBI_Ref = | ChEBI = | ChEMBL_Ref = | ChEMBL = | NIAID_ChemDB = | PDB_ligand = | synonyms =
| IUPAC_name = | chemical_formula = | C= | H= | Ag= | Al= | As= | Au= | B= | Bi= | Br= | Ca= | Cl= | Co= | F= | Fe= | Gd= | I= | K= | Li= | Mg= | Mn= | N= | Na= | O= | P= | Pt= | S= | Sb= | Se= | Sr= | Tc= | Zn= | charge= | molecular_weight = | SMILES = | StdInChI = | StdInChI_comment = | StdInChIKey = | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation =
Tocofersolan (INN; also known as tocophersolan, tocopherol polyethylene glycol succinate, or TPGS) is a synthetic water-soluble version of vitamin E. Natural forms of vitamin E are fat soluble, but not water-soluble. Tocofersolan is a polyethylene glycol (PEG) derivative of α-tocopherol succinate. The addition of PEG enables water solubility.
Tocofersolan is used as a vitamin E supplement or to treat vitamin E deficiency in individuals who cannot absorb fats due to disease. On 24 July 2009 the European Medicines Agency approved tocofersolan under the trade name Vedrop 50 mg/ml oral solution for the treatment of vitamin E deficiency due to digestive malabsorption in paediatric patients with congenital or hereditary chronic cholestasis, from birth (in term newborns) to 16 or 18 years of age (depending on the region).
Tocofersolan is also used in cosmetics and pharmaceuticals as an antioxidant.
References
References
- (19 June 2019). "Vedrop 50 mg/ml oral solution - Summary of Product Characteristics (SmPC)".
- "Vedrop EPAR".
- "Tocophersolan Oral". [[WebMD]].
- "Vedrop Summary of Product Characteristics". [[European Medicines Agency]].
- (2004). "Handbook of Preservatives". Synapse Info Resources.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::