Tesetaxel

Chemical compound
title: "Tesetaxel" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["mitotic-inhibitors", "benzoate-esters", "carbamates", "pyridines", "organofluorides", "ketones", "acetate-esters", "taxanes", "tert-butyl-compounds"] description: "Chemical compound" topic_path: "general/mitotic-inhibitors" source: "https://en.wikipedia.org/wiki/Tesetaxel" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 448210005 | IUPAC_name = (2aS,2bR,3S,4S,6S,8aR,10S,11aS,11bR,13aR)-2a-(acetyloxy)-6-{[(2R,3S)-3-[(tert-butoxycarbonyl)amino]-3-(3-fluoropyridin-2-yl)-2-hydroxypropanoyl]oxy}-10-[(dimethylamino)methyl]-4-hydroxy-7,11b,14,14-tetramethyl-2a,2b,3,4,5,6,8a,11a,11b,12,13,13a-dodecahydro-2H-4,8-methano[1,3]dioxolo[3,4]cyclodeca[1,2-d][1]benzoxet-3-yl benzoate | image = Tesetaxel.svg | image_class = skin-invert-image | tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Investigational | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = | CAS_number = 333754-36-2 | ATC_prefix = none | ATC_suffix = | PubChem = 6918574 | DrugBank_Ref = | DrugBank = | UNII_Ref = | UNII = UG97LO5M8Y | ChemSpiderID_Ref = | ChemSpiderID = 5293771
| C=46 | H=60 | F=1 | N=3 | O=13 | StdInChI_Ref = | StdInChI=1S/C46H60FN3O13/c1-24-28(58-40(54)34(52)33(32-27(47)17-14-20-48-32)49-41(55)63-42(3,4)5)21-46(56)38(61-39(53)26-15-12-11-13-16-26)36-44(8,19-18-29-45(36,23-57-29)62-25(2)51)37-35(31(24)43(46,6)7)59-30(60-37)22-50(9)10/h11-17,20,28-30,33-38,52,56H,18-19,21-23H2,1-10H3,(H,49,55)/t28-,29+,30+,33-,34+,35+,36-,37+,38-,44+,45-,46+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = MODVSQKJJIBWPZ-VLLPJHQWSA-N | smiles = CC1=C2[C@@H]3C@HOC@@HCN(C)C
Tesetaxel is an orally administered taxane being investigated as a chemotherapy agent for various types of cancer, including breast cancer, gastric cancer, colorectal cancer, and other solid tumors. It differs from other members of the taxane class (e.g. paclitaxel or docetaxel) in that it is administered orally, not intravenously.
References
References
- {{ClinicalTrialsGov. NCT01221870. Tesetaxel as First-line Therapy for Metastatic Breast Cancer
- (June 2006). "A phase II study of DJ-927 as second-line therapy in patients (pts) with advanced gastric cancer (GC) who have failed a 5-FU non taxane based regimen". Journal of Clinical Oncology.
- {{ClinicalTrialsGov. NCT00080834. DJ-927 as Second-Line Therapy in Treating Patients With Progressive Locally Advanced or Metastatic Colorectal Adenocarcinoma
- {{ClinicalTrialsGov. NCT01315431. A Study of Tesetaxel Plus Capecitabine in Patients With Solid Tumors
- (May 2003). "DJ-927, a novel oral taxane, overcomes P-glycoprotein-mediated multidrug resistance in vitro and in vivo". Cancer Science.
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::