Terbogrel

Quality 0.50 · 0 views · Updated 2 months ago

title: "Terbogrel" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["antiplatelet-drugs", "3-pyridyl-compounds", "guanidines", "nitriles", "tert-butyl-compounds"] topic_path: "general/antiplatelet-drugs" source: "https://en.wikipedia.org/wiki/Terbogrel" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 470602217 | ImageFile = Terbogrel.svg | ImageSize = | IUPACName = (5E)-6-{3-[tert-Butyl(cyano)carbamimidamido]phenyl}-6-pyridin-3-ylhex-5-enoic acid | OtherNames = (5E)-6-[m-(3-tert-Butyl-2-cyanoguanidino)phenyl]-6-(3-pyridyl)-5-hexenoic acid | Section1 = {{Chembox Identifiers | UNII_Ref = | UNII = 5Z4KWQ5OGN | CASNo_Ref = | CASNo = 149979-74-8 | ChEMBL_Ref = | ChEMBL = 281398 | PubChem = 6449876 | ChemSpiderID_Ref = | ChemSpiderID = 4952549 | KEGG_Ref = | KEGG = D06077 | StdInChI_Ref = | StdInChI = 1S/C23H27N5O2/c1-23(2,3)28-22(26-16-24)27-19-10-6-8-17(14-19)20(11-4-5-12-21(29)30)18-9-7-13-25-15-18/h6-11,13-15H,4-5,12H2,1-3H3,(H,29,30)(H2,26,27,28)/b20-11+ | StdInChIKey_Ref = | StdInChIKey = XUTLOCQNGLJNSA-RGVLZGJSSA-N | SMILES = N#CN\C(=N/C(C)(C)C)Nc2cccc(C(=C/CCCC(=O)O)\c1cccnc1)c2 | InChI = InChI=1S/C23H27N5O2/c1-23(2,3)28-22(26-16-24)27-19-10-6-8-17(14-19)20(11-4-5-12-21(29)30)18-9-7-13-25-15-18/h6-11,13-15H,4-5,12H2,1-3H3,(H,29,30)(H2,26,27,28)/b20-11+ | Section2 = {{Chembox Properties | C=23 | H=27 | N=5 | O=2 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt =

Terbogrel (INN) is an experimental drug that has been studied for its potential to prevent the vasoconstricting and platelet-aggregating action of thromboxanes. Terbogrel is an orally available thromboxane A2 receptor antagonist and a thromboxane A synthase inhibitor. The drug was developed by Boehringer Ingelheim.

A phase 2 clinical trial of terbogrel was discontinued due to its induction of leg pain.

References

References

  1. (1997). "International Nonproprietary Names for Pharmaceutical Substances (INN). Recommended International Nonproprietary Names (Rec. INN): List 37". WHO Drug Information.
  2. (July 2004). "Pharmacokinetics and Pharmacodynamics of Terbogrel, a Combined Thromboxane A2 Receptor and Synthase Inhibitor, in Healthy Subjects". British Journal of Clinical Pharmacology.
  3. (October 2000). "Terbogrel, a Dual-Acting Agent for Thromboxane Receptor Antagonism and Thromboxane Synthase Inhibition". Acta Crystallographica.
  4. (2014). "Impact of vascular thromboxane prostanoid receptor activation on hemostasis, thrombosis, oxidative stress, and inflammation". Journal of Thrombosis and Haemostasis.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

antiplatelet-drugs3-pyridyl-compoundsguanidinesnitrilestert-butyl-compounds