Sulfonmethane

Chemical compound
title: "Sulfonmethane" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["hypnotics", "sulfones", "gabaa-receptor-positive-allosteric-modulators"] description: "Chemical compound" topic_path: "general/hypnotics" source: "https://en.wikipedia.org/wiki/Sulfonmethane" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
::summary Chemical compound ::
| Verifiedfields = changed | verifiedrevid = 470473789 | IUPAC_name = 2,2-bis(ethylsulfonyl)propane | image = Sulfonal.svg | image_class = skin-invert-image | width = 200 | image2 = Sulfonal-3D-sticks.png | image_class2 = bg-transparent
| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = Schedule III | legal_status = | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = | CAS_number = 115-24-2 | ATC_prefix = none | ATC_suffix = | PubChem = 8262 | ChemSpiderID_Ref = | ChemSpiderID = 7964 | UNII_Ref = | UNII = W00D22B592
| C=7 | H=16 | O=4 | S=2 | smiles = O=S(=O)(C(C)(C)S(=O)(=O)CC)CC | StdInChI_Ref = | StdInChI = 1S/C7H16O4S2/c1-5-12(8,9)7(3,4)13(10,11)6-2/h5-6H2,1-4H3 | StdInChIKey_Ref = | StdInChIKey = CESKLHVYGRFMFP-UHFFFAOYSA-N | melting_point = | melting_high =
Sulfonmethane (sulfonomethane, sulfonal, acetone diethyl sulfone) is a chemical compound first synthesized by Eugen Baumann in 1888 and introduced as a hypnotic drug by Alfred Kast later on, but now superseded by newer and safer sedatives. Its appearance is either in colorless crystalline or powdered form. In United States, it is scheduled as a Schedule III drug in the Controlled Substances Act.
Chemistry
Sulfonal is prepared by condensing acetone with ethyl mercaptan in the presence of hydrochloric acid, the mercaptol (CH3)2C(SC2H5)2 formed being subsequently oxidized by potassium permanganate. It is also formed by the action of alcoholic potash and methyl iodide on ethylidene diethyl sulfine, CH3CH(SO2C2H5)2 (which is formed by the oxidation of dithioacetal with potassium permanganate). It crystallizes in prisms melting at 125 C, which are practically insoluble in cold water, but dissolves in 15 parts of hot water and also in alcohol and ether.
References
References
- DE Patent 46333
- [http://www.thefreedictionary.com/sulfonmethane American Heritage Dictionary]
- "DEA Scheduling".
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::