Spirotryprostatin A


title: "Spirotryprostatin A" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["alkaloids", "diketopiperazines", "heterocyclic-compounds-with-3-rings", "heterocyclic-compounds-with-2-rings", "methoxy-compounds"] topic_path: "general/alkaloids" source: "https://en.wikipedia.org/wiki/Spirotryprostatin_A" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 470470237 | Name = Spirotryprostatin A | ImageFile = SpirotryprostatinA.png | ImageName = Spirotryptostatin A | PIN = (2S,3S,5aS,10aS)-2′-Hydroxy-6′-methoxy-3-(2-methylprop-1-en-1-yl)-1,5a,6,7,8,10,10a-hexahydro-3H,5H,10H-spiro[dipyrrolo[1,2-a:1′,2′-d]pyrazine-2,3′-indole]-5,10-dione |Section1 = {{Chembox Identifiers | CASNo = 182234-25-9 | CASNo_Ref = | ChEMBL = 549475 | ChemSpiderID_Ref = | ChemSpiderID = 8583811 | PubChem = 10408374 | SMILES = CC(=C[C@H]1[C@]2(C[C@@H]3N1C(=O)[C@@H]4CCCN4C3=O)C5=C(C=C(C=C5)OC)NC2=O)C | StdInChI_Ref = | StdInChI = 1S/C22H25N3O4/c1-12(2)9-18-22(14-7-6-13(29-3)10-15(14)23-21(22)28)11-17-19(26)24-8-4-5-16(24)20(27)25(17)18/h6-7,9-10,16-18H,4-5,8,11H2,1-3H3,(H,23,28)/t16-,17-,18-,22-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = MQJKGSIAJNXSCM-ORGXJRBJSA-N |Section2 = {{Chembox Properties | Formula = C22H25N3O4 | MolarMass = 395.43 g/mol}} Spirotryprostatin A is an indolic alkaloid from the 2,5-Diketopiperazine class of natural products found in the Aspergillus fumigatus fungus. Spirotryprostatin A and several other indolic alkaloids (including Spirotryprostatin B, as well as other tryprostatins and cyclotryprostatins) have been found to have anti-mitotic properties, and as such they have become of great interest as anti-cancer drugs. Because of this, the total syntheses of these compounds is a major pursuit of organic chemists, and a number of different syntheses have been published in the chemical literature.

One such total synthesis was published in 1999, which showed that the isopropylidene side chain was not necessary to the biological activity of the compound, leading to a number of new theorized analogues.

References

References

  1. Borthwick AD. (2012). "2,5-Diketopiperazines: Synthesis, Reactions, Medicinal Chemistry, and Bioactive Natural Products". Chemical Reviews.
  2. Edmondson, S. (1999). "Total Synthesis of Spirotryprostatin A, Leading to the Discovery of Some Biologically Promising Analogues". J. Am. Chem. Soc..

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

alkaloidsdiketopiperazinesheterocyclic-compounds-with-3-ringsheterocyclic-compounds-with-2-ringsmethoxy-compounds