Solvent Violet 13

title: "Solvent Violet 13" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["solvent-dyes", "anthraquinone-dyes", "phenol-dyes", "anilines", "4-tolyl-compounds"] topic_path: "general/solvent-dyes" source: "https://en.wikipedia.org/wiki/Solvent_Violet_13" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0
| Verifiedimages = changed | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 444114255 | ImageFile_Ref = | ImageFile = Solvent Violet 13.png | ImageSize = | PIN = 1-Hydroxy-4-(4-methylanilino)anthracene-9,10-dione | OtherNames = |Section1={{Chembox Identifiers | InChI = 1/C21H15NO3/c1-12-6-8-13(9-7-12)22-16-10-11-17(23)19-18(16)20(24)14-4-2-3-5-15(14)21(19)25/h2-11,22-23H,1H3 | InChIKey = LJFWQNJLLOFIJK-UHFFFAOYAI | InChI1 = 1S/C21H15NO3/c1-12-6-8-13(9-7-12)22-16-10-11-17(23)19-18(16)20(24)14-4-2-3-5-15(14)21(19)25/h2-11,22-23H,1H3 | InChIKey1 = LJFWQNJLLOFIJK-UHFFFAOYSA-N
| CASNo_Ref = | CASNo = 81-48-1
| UNII_Ref = | UNII = 350KA7O6HK
| PubChem = 6680 | ChemSpiderID_Ref = | ChemSpiderID = 6428 | StdInChIKey_Ref = | StdInChIKey = LJFWQNJLLOFIJK-UHFFFAOYSA-N | SMILES = O=C2c1ccccc1C(=O)c3c2c(ccc3O)Nc4ccc(cc4)C | StdInChI_Ref = | StdInChI =1S/C21H15NO3/c1-12-6-8-13(9-7-12)22-16-10-11-17(23)19-18(16)20(24)14-4-2-3-5-15(14)21(19)25/h2-11,22-23H,1H3 |Section2={{Chembox Properties | C=21 | H=15 | N=1 | O=3 | Appearance = | Density = | MeltingPtC = 142 to 143 | MeltingPt_notes = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = Solvent Violet 13, also known as D&C Violet No.2, oil violet, Solvent Blue 90, Alizarine Violet 3B, Alizurol Purple, Duranol Brilliant Violet TG, Ahcoquinone Blue IR base, Quinizarin Blue, Disperse Blue 72, and C.I. 60725, is a synthetic anthraquinone dye with bright bluish violet hue. It is a solid insoluble in water and soluble in acetone, toluene, and benzene. Its chemical formula is C21H15NO3, and its structure is 1-hydroxy-4-(p-tolylamino)anthraquinone, or 1-hydroxy-4-[(4-methylphenyl)amino]-9,10-anthracenedione or 1-hydroxy-4-(4-methylanilino)anthraquinone.
Solvent Violet 13 is used to dye hydrocarbon products like solvents and petrol, thermoplastics, synthetic resins, e.g. polystyrenes, and synthetic fiber. It is also used in cosmetics, e.g. in hair and skin care products. In pyrotechnics, it is used in some violet colored smoke compositions.
References
References
- Hans-Samuel Bien, Josef Stawitz, Klaus Wunderlich "Anthraquinone Dyes and Intermediates" Ullmann's Encyclopedia of Industrial Chemistry 2002 Wiley-VCH, Weinhem. {{doi. 10.1002/14356007.a02_355
::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::