Solasodine


title: "Solasodine" type: doc version: 1 created: 2026-02-28 author: "Wikipedia contributors" status: active scope: public tags: ["steroidal-alkaloids", "plant-toxins", "steroidal-alkaloids-found-in-solanaceae", "spiro-compounds"] topic_path: "general/steroidal-alkaloids" source: "https://en.wikipedia.org/wiki/Solasodine" license: "CC BY-SA 4.0" wikipedia_page_id: 0 wikipedia_revision_id: 0

| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477858890 | ImageFile = Solasodine.svg | IUPACName = (22R,25R)-Spirosol-5α-en-3β-ol | SystematicName = (2S,2′R,4aR,4bS,5′R,6aS,6bR,7S,9aS,10aS,10bS)-4a,5′,6a,7-Tetramethyl-1,2,3,4,4a,4b,5,6,6a,6b,7,9a,10,10a,10b,11-hexadecahydrospiro[naptho[2′,1′:4,5]indeno[2,1-b]furan-8,2′-piperidin]-2-ol | OtherNames = Purapuridine; Solancarpidine; Solanearpidine; Solanidine-S |Section1={{Chembox Identifiers | Abbreviations = | CASNo = 126-17-0 | CASNo_Ref = | UNII_Ref = | UNII = L40Y453Y96 | EINECS = 204-774-2 | PubChem = 442985 | ChemSpiderID_Ref = | ChemSpiderID = 391288 | ChEMBL_Ref = | ChEMBL = 514596 | SMILES = O[C@@H]6C/C5=C/C[C@@H]1C@H[C@@]5(C)CC6 | StdInChI_Ref = | StdInChI=1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28-29H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 | StdInChIKey_Ref = | StdInChIKey = KWVISVAMQJWJSZ-VKROHFNGSA-N | RTECS = | MeSHName = | ChEBI_Ref = | ChEBI = 9190 | KEGG_Ref = | KEGG = C10822 |Section2={{Chembox Properties | C=27 | H=43 | N=1 | O=2 | Appearance = | Density = | MeltingPt = | MeltingPt_notes = | BoilingPt = | BoilingPt_notes = | Solubility = | SolubleOther = | Solvent = | pKa = | pKb = |Section7={{Chembox Hazards | ExternalSDS = | MainHazards = | NFPA-H = | NFPA-F = | NFPA-R = | NFPA-S = | HPhrases = | PPhrases = | GHS_ref = | FlashPt = | AutoignitionPt = | ExploLimits = | PEL =

Solasodine is a poisonous alkaloid chemical compound that occurs in plants of the family Solanaceae such as potatoes and tomatoes. Solasonine and solamargine are glycoalkaloid derivatives of solasodine. A 2013 literature survey found that various studies have indicated that solasodine may have diuretic, anticancer, antifungal, cardiotonic, antispermatogenetic, antiandrogenic, immunomodulatory, antipyretic and/or various other effects on central nervous system.

Uses

It is commercially used as a precursor for the production of complex steroidal compounds such as contraceptive pills, via a 16-DPA intermediate.

References

References

  1. Everist, S.L.. (1981). "Poisonous Plants of Australia". Angus & Robertson.
  2. Kinghorn, A.D.. (2010). "Toxic plants". Society for Economic Botany, Columbia University Press.
  3. Patel, Kanika. (2013). "Medicinal significance, pharmacological activities, and analytical aspects of solasodine: A concise report of current scientific literature". Journal of Acute Disease.

::callout[type=info title="Wikipedia Source"] This article was imported from Wikipedia and is available under the Creative Commons Attribution-ShareAlike 4.0 License. Content has been adapted to SurfDoc format. Original contributors can be found on the article history page. ::

steroidal-alkaloidsplant-toxinssteroidal-alkaloids-found-in-solanaceaespiro-compounds